2-{2-[1-({3-[4-(Trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}-methyl)piperidin-2-yl]ethyl}pyridine hydrochloride

ID: ALA5176269

PubChem CID: 168275420

Max Phase: Preclinical

Molecular Formula: C22H24ClF3N4O

Molecular Weight: 416.45

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cl.FC(F)(F)c1ccc(-c2noc(CN3CCCCC3CCc3ccccn3)n2)cc1

Standard InChI:  InChI=1S/C22H23F3N4O.ClH/c23-22(24,25)17-9-7-16(8-10-17)21-27-20(30-28-21)15-29-14-4-2-6-19(29)12-11-18-5-1-3-13-26-18;/h1,3,5,7-10,13,19H,2,4,6,11-12,14-15H2;1H

Standard InChI Key:  JUWXEQLYVPJNLG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    5.7142   -0.0223    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.7691    0.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4837   -0.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0570   -0.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0570   -1.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7672   -1.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4837   -1.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1984   -1.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1984   -2.4505    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9132   -1.2125    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9132   -2.0379    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3423    0.0289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2560    0.8493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4491    1.0208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0367    0.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5886   -0.3065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7885    0.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2011    1.0212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2011    2.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7885    1.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0265    1.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4391    1.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0265    2.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4391    0.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2643    0.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6771   -0.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5024   -0.4084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9132   -1.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5004   -1.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6792   -1.8379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2626   -1.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  4  2  1  0
  5  4  2  0
  6  5  1  0
  3  7  1  0
  7  6  2  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
 12  4  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 12  1  0
 15 17  1  0
 17 18  1  0
 19 20  1  0
 20 18  1  0
 18 21  1  0
 21 22  1  0
 19 23  1  0
 22 23  1  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
M  END

Associated Targets(Human)

GLP1R Tclin Glucagon-like peptide 1 receptor (111429 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Glp1r Glucagon-like peptide 1 receptor (331 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.45Molecular Weight (Monoisotopic): 416.1824AlogP: 5.14#Rotatable Bonds: 6
Polar Surface Area: 55.05Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.72CX LogP: 5.10CX LogD: 4.61
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -2.02

References

1. Decara JM, Vázquez-Villa H, Brea J, Alonso M, Srivastava RK, Orio L, Alén F, Suárez J, Baixeras E, García-Cárceles J, Escobar-Peña A, Lutz B, Rodríguez R, Codesido E, Garcia-Ladona FJ, Bennett TA, Ballesteros JA, Cruces J, Loza MI, Benhamú B, Rodríguez de Fonseca F, López-Rodríguez ML..  (2022)  Discovery of V-0219: A Small-Molecule Positive Allosteric Modulator of the Glucagon-Like Peptide-1 Receptor toward Oral Treatment for "Diabesity".,  65  (7.0): [PMID:35349261] [10.1021/acs.jmedchem.1c01842]

Source