3-ethyl-3-(4-(4-(3-(2-fluoroethoxy)phenyl)piperazin-1-yl)butyl)indolin-2-one

ID: ALA5176380

PubChem CID: 154926540

Max Phase: Preclinical

Molecular Formula: C26H34FN3O2

Molecular Weight: 439.58

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC1(CCCCN2CCN(c3cccc(OCCF)c3)CC2)C(=O)Nc2ccccc21

Standard InChI:  InChI=1S/C26H34FN3O2/c1-2-26(23-10-3-4-11-24(23)28-25(26)31)12-5-6-14-29-15-17-30(18-16-29)21-8-7-9-22(20-21)32-19-13-27/h3-4,7-11,20H,2,5-6,12-19H2,1H3,(H,28,31)

Standard InChI Key:  ZVCXQYWELOUODL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    5.3003   -2.0451    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.4794   -1.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1400   -1.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3191   -1.1290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9634   -0.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1425   -0.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8142    0.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3067    1.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1002    1.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4560    0.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9932    0.5128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5280   -0.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2928   -0.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6485    0.7043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1559    1.3610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6649    1.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4421    0.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9346    0.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7555    0.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2207   -0.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0416   -0.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7132   -1.1563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2074   -1.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8078   -0.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0540   -1.4299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3003    0.0202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8351    0.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9992    1.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3973    2.0451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6311    1.7988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4395    1.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0416    0.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  2  0
  7  6  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  5 10  1  0
 11  7  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 11 16  1  0
 17 14  1  0
 18 17  1  0
 19 18  1  0
 19 20  1  0
 21 20  1  0
 21 22  1  0
 21 24  1  0
 24 25  2  0
 26 24  1  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 32 21  1  0
 22 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5176380

    ---

Associated Targets(non-human)

Htr7 Serotonin 7 (5-HT7) receptor (811 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.58Molecular Weight (Monoisotopic): 439.2635AlogP: 4.63#Rotatable Bonds: 10
Polar Surface Area: 44.81Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.24CX Basic pKa: 8.34CX LogP: 5.00CX LogD: 4.01
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -0.84

References

1. Fu H, Rong J, Chen Z, Zhou J, Collier T, Liang SH..  (2022)  Positron Emission Tomography (PET) Imaging Tracers for Serotonin Receptors.,  65  (16.0): [PMID:35939391] [10.1021/acs.jmedchem.2c00633]

Source