The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N2,N4-bis(3-(trifluoromethoxy)phenyl)pyrimidine-2,4-diamine ID: ALA5176406
PubChem CID: 168272120
Max Phase: Preclinical
Molecular Formula: C18H12F6N4O2
Molecular Weight: 430.31
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: FC(F)(F)Oc1cccc(Nc2ccnc(Nc3cccc(OC(F)(F)F)c3)n2)c1
Standard InChI: InChI=1S/C18H12F6N4O2/c19-17(20,21)29-13-5-1-3-11(9-13)26-15-7-8-25-16(28-15)27-12-4-2-6-14(10-12)30-18(22,23)24/h1-10H,(H2,25,26,27,28)
Standard InChI Key: OIFMJZQFMOEALB-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
-2.5005 -1.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7859 -0.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0740 -1.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0740 -2.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7842 -2.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5005 -2.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7859 -0.0519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0713 0.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0710 1.1859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3581 1.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3565 1.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3581 0.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3536 -0.0536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3581 2.4217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3564 2.8343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3565 3.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0693 4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7843 3.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7859 2.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0740 2.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5006 2.4239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2151 2.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9298 2.4239 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8026 3.5511 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6277 3.5511 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 -2.5304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 -3.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9298 -3.7682 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8026 -4.0702 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.4181 -3.1420 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
2 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
10 14 1 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
19 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
6 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.31Molecular Weight (Monoisotopic): 430.0864AlogP: 5.76#Rotatable Bonds: 6Polar Surface Area: 68.30Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.93CX Basic pKa: 4.43CX LogP: 7.07CX LogD: 7.06Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -1.15
References 1. De S, Aamna B, Sahu R, Parida S, Behera SK, Dan AK.. (2022) Seeking heterocyclic scaffolds as antivirals against dengue virus., 240 [PMID:35816877 ] [10.1016/j.ejmech.2022.114576 ]