The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5176415
PubChem CID: 168272557
Max Phase: Preclinical
Molecular Formula: C24H27NO7
Molecular Weight: 441.48
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC34C=CC(=O)[C@@](C)(CCC(=O)Nc5c(O)ccc(C(=O)O)c5O)[C@@H]3[C@H](C[C@@H]1C4)O2
Standard InChI: InChI=1S/C24H27NO7/c1-22(7-6-17(28)25-18-14(26)4-3-13(19(18)29)21(30)31)16(27)5-8-24-10-12-9-15(20(22)24)32-23(12,2)11-24/h3-5,8,12,15,20,26,29H,6-7,9-11H2,1-2H3,(H,25,28)(H,30,31)/t12-,15+,20+,22-,23+,24?/m1/s1
Standard InChI Key: CSOMAHTTWTVBFL-AMPMPRDPSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-2.3128 0.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5983 1.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8838 0.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8838 -0.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5983 -0.5021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3128 -0.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1695 -0.5020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1695 1.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8838 1.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5447 0.7354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2590 1.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9733 0.7354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2590 1.9725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9733 -0.0893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2559 -0.5035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2607 -1.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9722 -1.7367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6875 -0.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6867 -1.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4017 -0.0895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4010 -1.7366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1153 -1.3242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4010 -2.5614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5416 -0.0911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0748 1.0367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3187 1.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8588 2.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0432 2.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4761 1.9634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1153 2.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4060 2.0851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0993 1.5320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
1 6 1 0
4 7 2 0
3 8 1 0
3 9 1 1
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
16 15 2 0
17 16 1 0
18 14 2 0
19 18 1 0
19 17 2 0
18 20 1 0
19 21 1 0
21 22 1 0
21 23 2 0
15 24 1 0
1 25 1 0
26 25 1 0
27 26 1 0
28 27 1 0
29 28 1 0
2 29 1 0
26 30 1 0
26 31 1 6
29 31 1 6
1 32 1 0
27 32 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.48Molecular Weight (Monoisotopic): 441.1788AlogP: 3.23#Rotatable Bonds: 5Polar Surface Area: 133.16Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.96CX Basic pKa: ┄CX LogP: 3.24CX LogD: -0.25Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: 2.65
References 1. Troudi A, Pagès JM, Brunel JM.. (2021) Chemical Highlights Supporting the Role of Lipid A in Efficient Biological Adaptation of Gram-Negative Bacteria to External Stresses., 64 (4.0): [PMID:33538159 ] [10.1021/acs.jmedchem.0c02185 ]