3-(2-Methoxyphenyl)-1-(pyridin-2-yl)-1H-pyrazol-5(4H)-one

ID: ALA5176505

PubChem CID: 155577610

Max Phase: Preclinical

Molecular Formula: C15H13N3O2

Molecular Weight: 267.29

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1C1=NN(c2ccccn2)C(=O)C1

Standard InChI:  InChI=1S/C15H13N3O2/c1-20-13-7-3-2-6-11(13)12-10-15(19)18(17-12)14-8-4-5-9-16-14/h2-9H,10H2,1H3

Standard InChI Key:  FHBSBNDBGZHUGX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
    1.1928   -0.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5481   -1.1055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1624   -0.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0675    0.1469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9022    0.1412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3148    0.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9025    1.5706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3144    2.2826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1398    2.2826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5517    1.5723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1435    0.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9595   -0.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1733   -1.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9681   -1.9113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5517   -1.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3408   -0.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5455   -0.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0179   -0.5907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5898   -2.2826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2071   -2.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  1  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  6 11  1  0
 11 10  2  0
 12  3  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 12 17  1  0
 17 16  2  0
  1 18  2  0
 13 19  1  0
 19 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5176505

    ---

Associated Targets(Human)

CD274 Tclin Programmed cell death 1 ligand 1 (299 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDCD1 Tclin Programmed cell death protein 1/Programmed cell death 1 ligand 1 (1367 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 267.29Molecular Weight (Monoisotopic): 267.1008AlogP: 2.23#Rotatable Bonds: 3
Polar Surface Area: 54.79Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.98CX LogP: 2.17CX LogD: 2.17
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.86Np Likeness Score: -1.05

References

1. Le Biannic R, Magnez R, Klupsch F, Leleu-Chavain N, Thiroux B, Tardy M, El Bouazzati H, Dezitter X, Renault N, Vergoten G, Bailly C, Quesnel B, Thuru X, Millet R..  (2022)  Pyrazolones as inhibitors of immune checkpoint blocking the PD-1/PD-L1 interaction.,  236  [PMID:35429911] [10.1016/j.ejmech.2022.114343]

Source