3-amino-6-(4-((4-(methyl-11C)piperazin-1-yl)sulfonyl)phenyl)-N-(pyridin-3-yl)pyrazine-2-carboxamide

ID: ALA5176600

PubChem CID: 168274123

Max Phase: Preclinical

Molecular Formula: C21H23N7O3S

Molecular Weight: 453.53

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  [11CH3]N1CCN(S(=O)(=O)c2ccc(-c3cnc(N)c(C(=O)Nc4cccnc4)n3)cc2)CC1

Standard InChI:  InChI=1S/C21H23N7O3S/c1-27-9-11-28(12-10-27)32(30,31)17-6-4-15(5-7-17)18-14-24-20(22)19(26-18)21(29)25-16-3-2-8-23-13-16/h2-8,13-14H,9-12H2,1H3,(H2,22,24)(H,25,29)/i1-1

Standard InChI Key:  FHCSBLWRGCOVPT-BJUDXGSMSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -1.6534    0.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0654    1.3744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6538    2.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8279    2.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4116    1.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8242    0.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4141    1.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8273    2.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6507    2.0886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0638    1.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6542    0.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8289    0.6560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8912    1.3744    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3041    0.6592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6064    1.7874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8912    2.2003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8912   -0.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3041   -0.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1300   -0.7710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5429   -0.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1300    0.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5429   -1.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8896    1.3732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0672   -0.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8930   -0.0544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6542   -0.7696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3060   -0.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1319   -0.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5429   -1.4833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1299   -2.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3081   -2.2003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8913   -1.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  7  5  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
  7 12  1  0
 12 11  2  0
  2 13  1  0
 13 14  1  0
 13 15  2  0
 13 16  2  0
 17 14  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 14 21  1  0
 19 22  1  0
 10 23  1  0
 11 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
M  ISO  1  22  11
M  END

Associated Targets(Human)

GSK3A Tclin Glycogen synthase kinase-3 (736 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.53Molecular Weight (Monoisotopic): 453.1583AlogP: 1.31#Rotatable Bonds: 5
Polar Surface Area: 134.41Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.01CX LogP: 1.15CX LogD: 1.13
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: -1.83

References

1. Chen Z, Haider A, Chen J, Xiao Z, Gobbi L, Honer M, Grether U, Arnold SE, Josephson L, Liang SH..  (2021)  The Repertoire of Small-Molecule PET Probes for Neuroinflammation Imaging: Challenges and Opportunities beyond TSPO.,  64  (24.0): [PMID:34905377] [10.1021/acs.jmedchem.1c01571]

Source