butyl 5-isobutyl-3-(4-(pyrrolidine-1-carbonyl)phenyl)thiophen-2-ylsulfonylcarbamate

ID: ALA517685

PubChem CID: 44567816

Max Phase: Preclinical

Molecular Formula: C24H32N2O5S2

Molecular Weight: 492.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(C(=O)N2CCCC2)cc1

Standard InChI:  InChI=1S/C24H32N2O5S2/c1-4-5-14-31-24(28)25-33(29,30)23-21(16-20(32-23)15-17(2)3)18-8-10-19(11-9-18)22(27)26-12-6-7-13-26/h8-11,16-17H,4-7,12-15H2,1-3H3,(H,25,28)

Standard InChI Key:  JAVKHUMSFXERNK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    0.9943   -2.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2774   -2.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2703   -3.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9820   -4.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7022   -3.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7057   -2.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9812   -5.0353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3106   -5.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5602   -6.3020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3852   -6.3076    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6453   -5.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4317   -5.2751    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.2129   -5.0164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6861   -6.0598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1791   -4.4897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8291   -5.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6634   -6.3729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6137   -5.3058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2804   -6.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1146   -7.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7316   -8.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5659   -9.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0707   -6.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4012   -7.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0883   -8.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2210   -7.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9980   -1.7365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7151   -1.3288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2862   -1.3193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4637   -1.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0198   -1.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6120   -0.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8040   -0.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 11  7  2  0
  4  7  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 12 15  2  0
 13 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
  1  2  2  0
 19 20  1  0
 20 21  1  0
  2  3  1  0
 21 22  1  0
  9 23  1  0
  3  4  2  0
 23 24  1  0
 24 25  1  0
  4  5  1  0
 24 26  1  0
  5  6  2  0
  6  1  1  0
 27 28  1  0
 27 29  2  0
  1 27  1  0
 28 30  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 28  1  0
M  END

Associated Targets(non-human)

Agtr1 Type-1A angiotensin II receptor (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGTR1 Type-1 angiotensin II receptor (25 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.66Molecular Weight (Monoisotopic): 492.1753AlogP: 5.06#Rotatable Bonds: 9
Polar Surface Area: 92.78Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.61CX Basic pKa: CX LogP: 5.63CX LogD: 4.69
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -0.79

References

1. Wallinder C, Botros M, Rosenström U, Guimond MO, Beaudry H, Nyberg F, Gallo-Payet N, Hallberg A, Alterman M..  (2008)  Selective angiotensin II AT2 receptor agonists: Benzamide structure-activity relationships.,  16  (14): [PMID:18599297] [10.1016/j.bmc.2008.05.066]

Source