4-((4aS,10bR)-7-ethoxy-1,2,3,4,4a,5,6,10b-octahydrobenzo[h][1,6]naphthyridin-5-yl)benzoic acid

ID: ALA5176884

PubChem CID: 168277805

Max Phase: Preclinical

Molecular Formula: C23H26N2O4

Molecular Weight: 394.47

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1cccc2c1N(C(C)=O)[C@@H](c1ccc(C(=O)O)cc1)[C@H]1CCCN[C@@H]21

Standard InChI:  InChI=1S/C23H26N2O4/c1-3-29-19-8-4-6-18-20-17(7-5-13-24-20)21(25(14(2)26)22(18)19)15-9-11-16(12-10-15)23(27)28/h4,6,8-12,17,20-21,24H,3,5,7,13H2,1-2H3,(H,27,28)/t17-,20+,21-/m0/s1

Standard InChI Key:  JLWIMWXOVPBUST-WMQCIHAUSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -3.2132    0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    1.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7868    0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7868   -0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4968   -0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2132   -0.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4968   -1.2370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2115   -1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2115   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0721   -0.4126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575   -0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0721    1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571   -0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0719   -0.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7840   -0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7840   -1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0737   -1.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571   -1.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0721   -1.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3575   -1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7868   -1.6504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0720    2.0629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3574    2.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3572    2.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571    1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6556    1.8211    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4677    0.8250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986   -1.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986   -2.4754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2132   -1.2377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  3 13  1  0
 11 14  1  6
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 10 20  1  0
 20 21  1  0
 20 22  2  0
 13 23  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 12 26  1  0
 13 27  1  1
 12 28  1  1
 29 17  1  0
 29 30  1  0
 29 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5176884

    ---

Associated Targets(Human)

JAR (316 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.47Molecular Weight (Monoisotopic): 394.1893AlogP: 3.93#Rotatable Bonds: 4
Polar Surface Area: 78.87Molecular Species: ZWITTERIONHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.02CX Basic pKa: 8.96CX LogP: 0.20CX LogD: 0.19
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.82Np Likeness Score: -0.03

References

1. Goebel GL, Hohnen L, Borgelt L, Hommen P, Qiu X, Lightfoot H, Wu P..  (2022)  Small molecules with tetrahydroquinoline-containing Povarov scaffolds as inhibitors disrupting the Protein-RNA interaction of LIN28-let-7.,  228  [PMID:34883291] [10.1016/j.ejmech.2021.114014]

Source