5-(4-(dibutylamino)butoxy)-2-(3,4-dimethoxyphenyl)-3,7-dimethoxy-4H-chromen-4-one

ID: ALA5177095

PubChem CID: 168273143

Max Phase: Preclinical

Molecular Formula: C31H43NO7

Molecular Weight: 541.69

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCN(CCCC)CCCCOc1cc(OC)cc2oc(-c3ccc(OC)c(OC)c3)c(OC)c(=O)c12

Standard InChI:  InChI=1S/C31H43NO7/c1-7-9-15-32(16-10-8-2)17-11-12-18-38-26-20-23(34-3)21-27-28(26)29(33)31(37-6)30(39-27)22-13-14-24(35-4)25(19-22)36-5/h13-14,19-21H,7-12,15-18H2,1-6H3

Standard InChI Key:  HXRCMTQBNWRVQS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
   -2.5001    2.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857    3.2999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0712    2.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0712    2.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3551    1.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3551    0.8262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0694    0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0694   -0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7839   -0.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7839   -1.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4984   -2.0610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2128   -1.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9272   -2.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6417   -1.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3561   -2.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4984   -2.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2128   -3.2985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2128   -4.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9272   -4.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3547    2.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0692    1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0692    0.8254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7836    2.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4980    1.6504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2125    2.0628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7836    2.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4980    3.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2155    2.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9271    3.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6416    2.8899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3561    3.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9271    4.1232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6400    4.5357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3544    4.1232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2109    4.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4980    4.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0692    3.3003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3547    2.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568    3.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 11 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  5 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 29 32  1  0
 32 33  1  0
 33 34  1  0
 32 35  2  0
 35 36  1  0
 36 27  2  0
 26 37  1  0
 38 37  1  0
 20 38  2  0
 38 39  1  0
 39  3  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5177095

    ---

Associated Targets(Human)

dsDNA (365 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 541.69Molecular Weight (Monoisotopic): 541.3040AlogP: 6.56#Rotatable Bonds: 17
Polar Surface Area: 79.60Molecular Species: BASEHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.12CX LogP: 5.45CX LogD: 2.79
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: 0.20

References

1. Rangel VM, Gu L, Chen G, Chen QH, Xue L..  (2022)  5-Substituted 3, 3', 4', 7-tetramethoxyflavonoids - A novel class of potent DNA triplex specific binding ligands.,  61  [PMID:35143982] [10.1016/j.bmcl.2022.128608]

Source