N-(4-Methyl-3-(4-(pyridin-4-yl)-1H-imidazol-2-ylamino)phenyl)-4-((4-methylpiperazin-1-yl)methyl)benzamide

ID: ALA517752

PubChem CID: 24970384

Max Phase: Preclinical

Molecular Formula: C28H31N7O

Molecular Weight: 481.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nc(-c2ccncc2)c[nH]1

Standard InChI:  InChI=1S/C28H31N7O/c1-20-3-8-24(17-25(20)32-28-30-18-26(33-28)22-9-11-29-12-10-22)31-27(36)23-6-4-21(5-7-23)19-35-15-13-34(2)14-16-35/h3-12,17-18H,13-16,19H2,1-2H3,(H,31,36)(H2,30,32,33)

Standard InChI Key:  IBXHREDWDHDYCU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    8.1574   -3.7210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1563   -4.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8712   -4.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5876   -4.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5848   -3.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8694   -3.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4429   -3.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3029   -4.9594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0167   -4.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0154   -3.7206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4415   -4.9604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4408   -5.7855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7702   -6.2686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0246   -7.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8497   -7.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1051   -6.2697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5390   -7.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7319   -4.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7213   -7.6300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2359   -8.2962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5708   -9.0513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3958   -9.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8775   -8.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7285   -5.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4428   -6.1919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1577   -5.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1537   -4.9488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4387   -4.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8734   -6.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8758   -7.0137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1592   -7.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1596   -8.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8735   -8.6586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5887   -8.2451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5899   -7.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8728   -9.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
  9 18  1  0
  4  5  1  0
 17 19  2  0
  2  3  1  0
 19 20  1  0
  9 10  2  0
 20 21  2  0
  5  6  2  0
 21 22  1  0
  2 11  1  0
 22 23  2  0
 23 17  1  0
  6  1  1  0
 18 24  2  0
 11 12  1  0
 24 25  1  0
 12 13  2  0
 25 26  2  0
  1  2  2  0
 26 27  1  0
  1  7  1  0
 27 28  2  0
 28 18  1  0
  3  4  2  0
 26 29  1  0
  4  8  1  0
 29 30  1  0
 30 31  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 14 17  1  0
 33 36  1  0
M  END

Associated Targets(non-human)

Pdgfrb Platelet-derived growth factor receptor (285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 481.60Molecular Weight (Monoisotopic): 481.2590AlogP: 4.52#Rotatable Bonds: 7
Polar Surface Area: 89.18Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.39CX Basic pKa: 8.03CX LogP: 4.19CX LogD: 3.23
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.61

References

1. Mahboobi S, Sellmer A, Eswayah A, Elz S, Uecker A, Böhmer FD..  (2008)  Inhibition of PDGFR tyrosine kinase activity by a series of novel N-(3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino)phenyl)amides: a SAR study on the bioisosterism of pyrimidine and imidazole.,  43  (7): [PMID:17983688] [10.1016/j.ejmech.2007.09.021]

Source