The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Methyl-3-(4-(pyridin-4-yl)-1H-imidazol-2-ylamino)phenyl)-4-((4-methylpiperazin-1-yl)methyl)benzamide ID: ALA517752
PubChem CID: 24970384
Max Phase: Preclinical
Molecular Formula: C28H31N7O
Molecular Weight: 481.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nc(-c2ccncc2)c[nH]1
Standard InChI: InChI=1S/C28H31N7O/c1-20-3-8-24(17-25(20)32-28-30-18-26(33-28)22-9-11-29-12-10-22)31-27(36)23-6-4-21(5-7-23)19-35-15-13-34(2)14-16-35/h3-12,17-18H,13-16,19H2,1-2H3,(H,31,36)(H2,30,32,33)
Standard InChI Key: IBXHREDWDHDYCU-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
8.1574 -3.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1563 -4.5485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8712 -4.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5876 -4.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5848 -3.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8694 -3.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4429 -3.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3029 -4.9594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0167 -4.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0154 -3.7206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4415 -4.9604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4408 -5.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7702 -6.2686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0246 -7.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8497 -7.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1051 -6.2697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5390 -7.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7319 -4.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7213 -7.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2359 -8.2962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5708 -9.0513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3958 -9.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8775 -8.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7285 -5.7807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4428 -6.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1577 -5.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1537 -4.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4387 -4.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8734 -6.1886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8758 -7.0137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1592 -7.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1596 -8.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8735 -8.6586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5887 -8.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5899 -7.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8728 -9.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
9 18 1 0
4 5 1 0
17 19 2 0
2 3 1 0
19 20 1 0
9 10 2 0
20 21 2 0
5 6 2 0
21 22 1 0
2 11 1 0
22 23 2 0
23 17 1 0
6 1 1 0
18 24 2 0
11 12 1 0
24 25 1 0
12 13 2 0
25 26 2 0
1 2 2 0
26 27 1 0
1 7 1 0
27 28 2 0
28 18 1 0
3 4 2 0
26 29 1 0
4 8 1 0
29 30 1 0
30 31 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
14 17 1 0
33 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.60Molecular Weight (Monoisotopic): 481.2590AlogP: 4.52#Rotatable Bonds: 7Polar Surface Area: 89.18Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.39CX Basic pKa: 8.03CX LogP: 4.19CX LogD: 3.23Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.61
References 1. Mahboobi S, Sellmer A, Eswayah A, Elz S, Uecker A, Böhmer FD.. (2008) Inhibition of PDGFR tyrosine kinase activity by a series of novel N-(3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino)phenyl)amides: a SAR study on the bioisosterism of pyrimidine and imidazole., 43 (7): [PMID:17983688 ] [10.1016/j.ejmech.2007.09.021 ]