The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[3-[2-(dipropylamino)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl]-4-fluoro-phenyl]methyl]-2H-phthalazin-1-one ID: ALA5177603
PubChem CID: 168276216
Max Phase: Preclinical
Molecular Formula: C29H31FN6O2
Molecular Weight: 514.61
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCN(CCC)c1ncc2c(n1)CCN(C(=O)c1cc(Cc3n[nH]c(=O)c4ccccc34)ccc1F)C2
Standard InChI: InChI=1S/C29H31FN6O2/c1-3-12-35(13-4-2)29-31-17-20-18-36(14-11-25(20)32-29)28(38)23-15-19(9-10-24(23)30)16-26-21-7-5-6-8-22(21)27(37)34-33-26/h5-10,15,17H,3-4,11-14,16,18H2,1-2H3,(H,34,37)
Standard InChI Key: LRWSEVGBTWOZDN-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-5.7145 1.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9999 2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2881 1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2881 1.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9981 0.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7145 1.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5734 2.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8588 1.8551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8588 1.0300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5734 0.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5734 3.0929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5734 -0.2077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8588 -0.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1440 -0.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4319 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4319 -1.4453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1421 -1.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8588 -1.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7171 -1.8579 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.7171 -0.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7171 0.6178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0026 -0.6199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7119 -0.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4266 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4266 -1.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7119 -1.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0026 -1.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1393 -0.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8541 -0.6215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8560 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1443 -1.8592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5706 -1.8552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2852 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9999 -1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2852 -3.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5706 -2.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7145 -1.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9999 -2.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 1 0
10 9 2 0
4 10 1 0
7 11 2 0
10 12 1 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
15 20 1 0
20 21 2 0
20 22 1 0
23 22 1 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 1 0
22 27 1 0
24 28 1 0
29 28 2 0
30 29 1 0
31 30 2 0
25 31 1 0
30 32 1 0
33 32 1 0
34 33 1 0
36 35 1 0
32 36 1 0
34 37 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.61Molecular Weight (Monoisotopic): 514.2493AlogP: 4.27#Rotatable Bonds: 8Polar Surface Area: 95.08Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.96CX Basic pKa: 2.61CX LogP: 4.53CX LogD: 4.53Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.38Np Likeness Score: -1.71
References 1. Lin S, Zhang X, Yu Z, Huang X, Xu J, Liu Y, Wu L.. (2022) Synthesis of novel dual target inhibitors of PARP and EGFR and their antitumor activities in triple negative breast cancers., 61 [PMID:35393219 ] [10.1016/j.bmc.2022.116739 ]