The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
kalmotoxin-IV ID: ALA517774
PubChem CID: 44584062
Max Phase: Preclinical
Molecular Formula: C22H34O8
Molecular Weight: 426.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Kalmotoxin IV | Kalmitoxin IV|Kalmotoxin IV|CHEMBL517774|NS00093902
Canonical SMILES: CC(=O)O[C@@H]1[C@@H](O)[C@]23C[C@@](C)(O)[C@H](CC[C@H]2[C@@](C)(O)[C@@H]2[C@@H]4O[C@@H]4C(C)(C)[C@@]12O)[C@H]3O
Standard InChI: InChI=1S/C22H34O8/c1-9(23)29-17-15(25)21-8-19(4,26)10(14(21)24)6-7-11(21)20(5,27)13-12-16(30-12)18(2,3)22(13,17)28/h10-17,24-28H,6-8H2,1-5H3/t10-,11+,12+,13+,14-,15-,16+,17-,19-,20-,21-,22+/m1/s1
Standard InChI Key: PDIUEUBWQHNTIE-WSFASAQISA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
6.7235 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2971 -7.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1238 -7.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7870 -7.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9811 -6.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9596 -7.2161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4665 -6.3702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6441 -7.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4203 -7.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0274 -6.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8540 -6.0674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0716 -5.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8560 -7.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2392 -7.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0332 -7.4494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1293 -5.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1619 -7.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9535 -8.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9767 -5.5200 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.4665 -5.5458 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.7441 -6.4554 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.6434 -6.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2796 -5.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4998 -5.6283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9246 -8.5574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3915 -9.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0233 -10.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2308 -9.1999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0578 -7.0311 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.2796 -5.0875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.5384 -8.5305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6285 -8.2170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2336 -8.4940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3049 -5.2826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3702 -7.8594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
4 5 1 0
5 23 1 0
22 6 1 0
6 4 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
8 13 1 1
10 14 1 0
13 14 1 0
14 15 1 1
1 16 1 1
6 17 1 0
6 18 1 0
5 19 1 6
7 20 1 1
10 21 1 6
23 22 1 0
23 24 1 0
22 24 1 0
2 25 1 1
25 26 1 0
26 27 1 0
26 28 2 0
22 29 1 6
23 30 1 6
3 31 1 6
5 1 1 0
1 7 1 0
4 2 1 0
8 3 1 0
14 33 1 0
9 32 1 1
1 34 1 0
4 35 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.51Molecular Weight (Monoisotopic): 426.2254AlogP: -0.27#Rotatable Bonds: 1Polar Surface Area: 139.98Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.83CX Basic pKa: ┄CX LogP: -1.34CX LogD: -1.34Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.29Np Likeness Score: 3.32
References 1. El-Naggar SF, Doskotch RW, ODell TM, Girard L. (1980) Antifeedant Diterpenes For the Gypsy Moth Larvae From Kalmia latifolia: Isolation and Characterization of Ten Grayanoids, 43 (5): [10.1021/np50011a016 ]