6-fluoro-2-(4-(trifluoromethyl)phenyl)-4H-thiochromen-4-one 1,1-dioxide

ID: ALA5177826

PubChem CID: 162538689

Max Phase: Preclinical

Molecular Formula: C16H8F4O3S

Molecular Weight: 356.30

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1C=C(c2ccc(C(F)(F)F)cc2)S(=O)(=O)c2ccc(F)cc21

Standard InChI:  InChI=1S/C16H8F4O3S/c17-11-5-6-14-12(7-11)13(21)8-15(24(14,22)23)9-1-3-10(4-2-9)16(18,19)20/h1-8H

Standard InChI Key:  UNGRGOXVSCHUCG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   -2.8559    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1413    1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4294    1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4294    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1396   -0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8559    0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5706    1.4436    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148    1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0001    1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0001    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148   -0.2063    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148    2.2692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4292    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1413   -0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1413   -1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4310   -1.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -1.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8559   -1.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5706   -1.0314    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8559   -2.2692    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5706   -1.8565    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1281   -0.9223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3030   -0.9223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  1  7  1  0
  3  8  1  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
  4 11  1  0
  8 12  2  0
 13 10  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 13 18  1  0
 18 17  2  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 19 22  1  0
 11 23  2  0
 11 24  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5177826

    ---

Associated Targets(Human)

U-937 (7138 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Leishmania panamensis (230 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 356.30Molecular Weight (Monoisotopic): 356.0130AlogP: 3.86#Rotatable Bonds: 1
Polar Surface Area: 51.21Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.44CX LogD: 3.44
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.58Np Likeness Score: -0.85

References

1. Gupta O, Pradhan T, Bhatia R, Monga V..  (2021)  Recent advancements in anti-leishmanial research: Synthetic strategies and structural activity relationships.,  223  [PMID:34171661] [10.1016/j.ejmech.2021.113606]

Source