The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Aceneoherqueinone B ID: ALA5177969
PubChem CID: 168276629
Max Phase: Preclinical
Molecular Formula: C22H22O8
Molecular Weight: 414.41
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)C[C@]1(O)C(=O)C2=C3O[C@H](C)C(C)(C)[C@]3(O)C(=O)c3c(C)cc(O)c(c32)C1=O
Standard InChI: InChI=1S/C22H22O8/c1-8-6-11(24)13-14-12(8)18(27)22(29)19(30-10(3)20(22,4)5)15(14)17(26)21(28,16(13)25)7-9(2)23/h6,10,24,28-29H,7H2,1-5H3/t10-,21-,22+/m1/s1
Standard InChI Key: HUHPJCXENHMHHQ-QUKVIPBPSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
2.8335 -1.2845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0085 -1.2845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5235 -1.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7388 -1.6971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7388 -0.8720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0243 -0.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6901 -0.8720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6901 -1.6971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0243 -2.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0243 -2.9346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4046 -2.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1191 -1.6971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1191 -0.8720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4046 -0.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4046 0.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1191 0.7780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6901 0.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0243 0.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7388 0.7780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0774 1.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6402 2.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0276 2.9346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1843 2.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3028 1.5064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8335 -0.4595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4046 -2.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5235 -0.6171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8251 -2.5175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1307 -2.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3604 -2.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
3 2 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 1 0
9 10 2 0
8 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
7 14 1 0
14 15 1 0
15 16 2 0
17 15 1 0
17 18 1 0
6 18 1 0
18 19 2 0
17 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
17 24 1 1
13 25 1 0
11 26 1 0
5 27 1 0
2 27 1 0
4 28 1 1
3 29 1 0
3 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.41Molecular Weight (Monoisotopic): 414.1315AlogP: 1.26#Rotatable Bonds: 2Polar Surface Area: 138.20Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.24CX Basic pKa: ┄CX LogP: 1.84CX LogD: 0.70Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: 1.30
References 1. Li K, Chen S, Pang X, Cai J, Zhang X, Liu Y, Zhu Y, Zhou X.. (2022) Natural products from mangrove sediments-derived microbes: Structural diversity, bioactivities, biosynthesis, and total synthesis., 230 [PMID:35063731 ] [10.1016/j.ejmech.2022.114117 ]