Aceneoherqueinone B

ID: ALA5177969

PubChem CID: 168276629

Max Phase: Preclinical

Molecular Formula: C22H22O8

Molecular Weight: 414.41

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)C[C@]1(O)C(=O)C2=C3O[C@H](C)C(C)(C)[C@]3(O)C(=O)c3c(C)cc(O)c(c32)C1=O

Standard InChI:  InChI=1S/C22H22O8/c1-8-6-11(24)13-14-12(8)18(27)22(29)19(30-10(3)20(22,4)5)15(14)17(26)21(28,16(13)25)7-9(2)23/h6,10,24,28-29H,7H2,1-5H3/t10-,21-,22+/m1/s1

Standard InChI Key:  HUHPJCXENHMHHQ-QUKVIPBPSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    2.8335   -1.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0085   -1.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5235   -1.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7388   -1.6971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7388   -0.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0243   -0.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6901   -0.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6901   -1.6971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0243   -2.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0243   -2.9346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4046   -2.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1191   -1.6971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1191   -0.8720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4046   -0.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4046    0.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1191    0.7780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6901    0.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0243    0.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7388    0.7780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0774    1.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6402    2.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0276    2.9346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1843    2.1772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3028    1.5064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8335   -0.4595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4046   -2.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5235   -0.6171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8251   -2.5175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1307   -2.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3604   -2.7607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  1  0
  9 10  2  0
  8 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  7 14  1  0
 14 15  1  0
 15 16  2  0
 17 15  1  0
 17 18  1  0
  6 18  1  0
 18 19  2  0
 17 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 17 24  1  1
 13 25  1  0
 11 26  1  0
  5 27  1  0
  2 27  1  0
  4 28  1  1
  3 29  1  0
  3 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5177969

    ---

Associated Targets(Human)

ACE Tclin Angiotensin-converting enzyme (1423 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.41Molecular Weight (Monoisotopic): 414.1315AlogP: 1.26#Rotatable Bonds: 2
Polar Surface Area: 138.20Molecular Species: ACIDHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.24CX Basic pKa: CX LogP: 1.84CX LogD: 0.70
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: 1.30

References

1. Li K, Chen S, Pang X, Cai J, Zhang X, Liu Y, Zhu Y, Zhou X..  (2022)  Natural products from mangrove sediments-derived microbes: Structural diversity, bioactivities, biosynthesis, and total synthesis.,  230  [PMID:35063731] [10.1016/j.ejmech.2022.114117]

Source