The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,4S)/(3S,4R)-3-(4-Fluorobenzyl)-4-hydroxy-1-(4-methoxybenzyl)-3-(4-(methylsulfonyl)phenyl)pyrrolidin-2-one ID: ALA5177981
PubChem CID: 168277016
Max Phase: Preclinical
Molecular Formula: C26H26FNO5S
Molecular Weight: 483.56
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CN2C[C@@H](O)[C@@](Cc3ccc(F)cc3)(c3ccc(S(C)(=O)=O)cc3)C2=O)cc1
Standard InChI: InChI=1S/C26H26FNO5S/c1-33-22-11-5-19(6-12-22)16-28-17-24(29)26(25(28)30,15-18-3-9-21(27)10-4-18)20-7-13-23(14-8-20)34(2,31)32/h3-14,24,29H,15-17H2,1-2H3/t24-,26-/m1/s1
Standard InChI Key: FNYFCMKBTSFCJY-AOYPEHQESA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-4.1302 -2.1903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3052 -2.1903 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.7177 -1.4758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4385 -0.5610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0225 0.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1844 -1.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6405 -1.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8973 -0.5645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2280 -0.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2268 0.7471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6823 -0.3106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2946 -0.8635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1196 -1.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7312 -2.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5171 -1.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6881 -1.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0752 -0.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1302 -2.5193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9586 -3.3264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1927 -2.1735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1552 -0.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8667 -0.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5828 -0.9577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5880 -1.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8710 -2.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1578 -1.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3079 -3.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0302 0.8513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3163 1.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3237 2.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0431 2.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7571 2.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7463 1.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0520 3.3264 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 6
4 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 4 1 0
9 10 2 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 1 0
6 20 1 1
4 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 2 1 0
24 25 1 0
25 26 2 0
26 21 1 0
2 27 1 0
5 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.56Molecular Weight (Monoisotopic): 483.1516AlogP: 3.12#Rotatable Bonds: 7Polar Surface Area: 83.91Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.95CX Basic pKa: ┄CX LogP: 3.09CX LogD: 3.09Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -0.62
References 1. Kojima E, Iimuro A, Nakajima M, Kinuta H, Asada N, Sako Y, Nakata Z, Uemura K, Arita S, Miki S, Wakasa-Morimoto C, Tachibana Y.. (2022) Pocket-to-Lead: Structure-Based De Novo Design of Novel Non-peptidic HIV-1 Protease Inhibitors Using the Ligand Binding Pocket as a Template., 65 (8.0): [PMID:35416651 ] [10.1021/acs.jmedchem.1c02217 ]