The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R,E)-4-(3-(2,5-difluorophenyl)allyl)-1-(3-(3-fluoro-6-methoxyquinolin-4-yl)propyl)piperazine-2-carboxylic acid ID: ALA5178214
PubChem CID: 145147651
Max Phase: Preclinical
Molecular Formula: C27H28F3N3O3
Molecular Weight: 499.53
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2ncc(F)c(CCCN3CCN(C/C=C/c4cc(F)ccc4F)C[C@@H]3C(=O)O)c2c1
Standard InChI: InChI=1S/C27H28F3N3O3/c1-36-20-7-9-25-22(15-20)21(24(30)16-31-25)5-3-11-33-13-12-32(17-26(33)27(34)35)10-2-4-18-14-19(28)6-8-23(18)29/h2,4,6-9,14-16,26H,3,5,10-13,17H2,1H3,(H,34,35)/b4-2+/t26-/m1/s1
Standard InChI Key: XSSZBMPRNHMAKY-VJZHMDQISA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-5.0396 2.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0384 1.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3203 0.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6037 1.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6030 2.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8823 2.4960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1647 2.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1599 1.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4395 0.8364 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8834 0.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8834 0.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1630 -0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4425 0.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7221 -0.4130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0017 0.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7159 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7159 -1.2446 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4363 -1.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1566 -1.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8770 -1.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5975 -1.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5977 -0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3163 0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0370 -0.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0384 -1.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3210 -1.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.6598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7221 -1.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4425 -1.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1630 -1.2483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4425 -2.4960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7588 0.8378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7588 0.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8772 0.0030 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.7588 -1.6584 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.3257 2.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
4 3 1 0
5 4 1 0
6 5 2 0
7 6 1 0
8 7 2 0
8 9 1 0
10 8 1 0
4 10 2 0
11 10 1 0
11 12 1 0
12 13 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
27 17 1 0
28 27 1 0
14 28 1 0
28 29 1 6
29 30 1 0
29 31 2 0
2 32 1 0
32 33 1 0
22 34 1 0
25 35 1 0
1 36 2 0
5 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.53Molecular Weight (Monoisotopic): 499.2083AlogP: 4.38#Rotatable Bonds: 9Polar Surface Area: 65.90Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 0.27CX Basic pKa: 8.46CX LogP: 2.22CX LogD: 2.19Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.47Np Likeness Score: -0.97
References 1. Flagstad T, Pedersen MT, Jakobsen TH, Felding J, Tolker-Nielsen T, Givskov M, Qvortrup K, Nielsen TE.. (2022) Solid-phase synthesis and biological evaluation of piperazine-based novel bacterial topoisomerase inhibitors., 57 [PMID:34906671 ] [10.1016/j.bmcl.2021.128499 ]