The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl)-1-(4-fluorophenyl)butyl 4-carbamothioylbenzoate ID: ALA5178450
PubChem CID: 168272686
Max Phase: Preclinical
Molecular Formula: C29H30ClFN2O3S
Molecular Weight: 541.09
Associated Items:
Names and Identifiers Canonical SMILES: NC(=S)c1ccc(C(=O)OC(CCCN2CCC(O)(c3ccc(Cl)cc3)CC2)c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C29H30ClFN2O3S/c30-24-11-9-23(10-12-24)29(35)15-18-33(19-16-29)17-1-2-26(20-7-13-25(31)14-8-20)36-28(34)22-5-3-21(4-6-22)27(32)37/h3-14,26,35H,1-2,15-19H2,(H2,32,37)
Standard InChI Key: MMCCIZYTFHFNAC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-5.0159 2.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8021 3.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0075 3.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4241 2.9144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6350 2.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4301 1.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3856 3.8692 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.0515 1.5376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2545 1.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6710 1.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8846 0.3706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6816 0.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2651 0.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8379 2.3347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3011 -0.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5041 0.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0793 -0.5826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8763 -0.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4598 -0.9525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2569 -0.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8403 -1.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4704 0.0580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0899 0.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5066 1.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7201 1.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5175 2.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0992 1.4402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8904 0.6424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -1.1091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2187 -1.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0051 -2.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2124 -2.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6259 -2.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5885 -3.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3856 -2.8585 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3750 -3.8692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7311 2.8167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
2 7 1 0
5 8 1 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 1 0
8 14 1 0
11 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
18 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
29 21 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
21 33 1 0
31 34 1 0
34 35 2 0
34 36 1 0
26 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.09Molecular Weight (Monoisotopic): 540.1650AlogP: 5.78#Rotatable Bonds: 9Polar Surface Area: 75.79Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.78CX Basic pKa: 8.94CX LogP: 5.81CX LogD: 4.26Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -0.67
References 1. Dichiara M, Artacho-Cordón A, Turnaturi R, Santos-Caballero M, González-Cano R, Pasquinucci L, Barbaraci C, Rodríguez-Gómez I, Gómez-Guzmán M, Marrazzo A, Cobos EJ, Amata E.. (2022) Dual Sigma-1 receptor antagonists and hydrogen sulfide-releasing compounds for pain treatment: Design, synthesis, and pharmacological evaluation., 230 [PMID:35016113 ] [10.1016/j.ejmech.2021.114091 ]