(3R)-1-(1-(3,4-difluorobenzyl)-3-oxo-1,3-dihydroisobenzofuran-5-yl)pyrrolidine-3-carboxylic acid

ID: ALA5178479

PubChem CID: 168274204

Max Phase: Preclinical

Molecular Formula: C20H17F2NO4

Molecular Weight: 373.36

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1OC(Cc2ccc(F)c(F)c2)c2ccc(N3CC[C@@H](C(=O)O)C3)cc21

Standard InChI:  InChI=1S/C20H17F2NO4/c21-16-4-1-11(7-17(16)22)8-18-14-3-2-13(9-15(14)20(26)27-18)23-6-5-12(10-23)19(24)25/h1-4,7,9,12,18H,5-6,8,10H2,(H,24,25)/t12-,18?/m1/s1

Standard InChI Key:  OIKRFVLTXKLVOW-GKOGFXNCSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   -1.1855   -0.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4710    0.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2435   -0.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2435   -1.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0281   -1.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5131   -0.7737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0281   -0.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2831    0.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0901    0.8499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3451    1.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1521    1.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4070    2.5908    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.7042    1.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5112    1.3645    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.4492    0.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6422    0.2368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2831   -2.2258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4710   -1.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1855   -1.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9000   -1.5988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9862   -2.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7932   -2.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2058   -1.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0263   -1.7901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5112   -2.4575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3619   -1.0364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6537   -1.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  4  5  1  0
  6  5  1  0
  3  7  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 11 12  1  0
 13 11  2  0
 13 14  1  0
 15 13  1  0
 16 15  2  0
  9 16  1  0
  5 17  2  0
 18  4  1  0
 19 18  2  0
  1 19  1  0
 20 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  1
 24 25  1  0
 24 26  2  0
 23 27  1  0
 27 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5178479

    ---

Associated Targets(non-human)

Maob Monoamine oxidase B (2209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 373.36Molecular Weight (Monoisotopic): 373.1126AlogP: 3.33#Rotatable Bonds: 4
Polar Surface Area: 66.84Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.83CX Basic pKa: 2.34CX LogP: 3.55CX LogD: 0.49
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.83Np Likeness Score: -0.60

References

1. Liu K, Zhou S, Zhou J, Bo R, Wang X, Xu T, Yuan Y, Xu B..  (2022)  Discovery of 3, 6-disubstituted isobenzofuran-1(3H)-ones as novel inhibitors of monoamine oxidases.,  67  [PMID:35472505] [10.1016/j.bmcl.2022.128748]

Source