The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(biphenyl-4-ylmethylamino)propyl)-3,5-bis(trifluoromethyl)benzenesulfonamide ID: ALA5178644
PubChem CID: 168273238
Max Phase: Preclinical
Molecular Formula: C24H22F6N2O2S
Molecular Weight: 516.51
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(NCCCNCc1ccc(-c2ccccc2)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1
Standard InChI: InChI=1S/C24H22F6N2O2S/c25-23(26,27)20-13-21(24(28,29)30)15-22(14-20)35(33,34)32-12-4-11-31-16-17-7-9-19(10-8-17)18-5-2-1-3-6-18/h1-3,5-10,13-15,31-32H,4,11-12,16H2
Standard InChI Key: AQMYDOTWCRHUJD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
1.0742 0.8251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3597 1.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3547 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0692 1.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7836 0.8251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4981 1.2376 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.2125 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2128 0.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9254 -0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6401 0.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6417 0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9300 1.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3561 1.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0706 0.8230 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.3561 2.0604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.0706 1.6479 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.9254 -1.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2110 -1.6479 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.6399 -1.6479 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.9254 -2.0604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.0848 1.9534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9098 1.9534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7886 1.2376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5031 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2177 1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9296 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9296 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2195 -0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5031 -0.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6441 -0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3587 0.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0706 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0706 -1.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3605 -1.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6441 -1.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
7 12 1 0
11 13 1 0
13 14 1 0
13 15 1 0
13 16 1 0
9 17 1 0
17 18 1 0
17 19 1 0
17 20 1 0
6 21 2 0
6 22 2 0
1 23 1 0
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
30 27 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
30 35 1 0
35 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.51Molecular Weight (Monoisotopic): 516.1306AlogP: 5.85#Rotatable Bonds: 9Polar Surface Area: 58.20Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.93CX Basic pKa: 9.19CX LogP: 5.22CX LogD: 3.73Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -1.10
References 1. Sun J, Ambrus JI, Baker JR, Russell CC, Cossar PJ, Sakoff JA, Scarlett CJ, McCluskey A.. (2022) 3,5-Bis(trifluoromethyl)phenylsulfonamides, a novel pancreatic cancer active lead. Investigation of the terminal aromatic moiety., 61 [PMID:35114371 ] [10.1016/j.bmcl.2022.128591 ]