The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-amino-5-(2-(dimethylamino)ethyl)-8,9-dimethoxydibenzo[c,h][1,6]naphthyridin-6(5H)-one ID: ALA5178685
PubChem CID: 10363113
Max Phase: Preclinical
Molecular Formula: C22H24N4O3
Molecular Weight: 392.46
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(=O)n(CCN(C)C)c3c4ccc(N)cc4ncc3c2cc1OC
Standard InChI: InChI=1S/C22H24N4O3/c1-25(2)7-8-26-21-14-6-5-13(23)9-18(14)24-12-17(21)15-10-19(28-3)20(29-4)11-16(15)22(26)27/h5-6,9-12H,7-8,23H2,1-4H3
Standard InChI Key: ZQZUTLHKODWHQW-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-0.3572 0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 0.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 -0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 -0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -0.4123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 0.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 1.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 2.0627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 1.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7862 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5007 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5008 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7863 2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7863 0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5007 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5008 -0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 -0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 -1.6496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0716 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0716 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7860 -2.0623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7860 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5005 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2153 -0.8246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9297 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2152 0.8253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9297 0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2153 2.0623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 2 0
2 3 2 0
3 4 1 0
7 8 2 0
10 1 1 0
6 7 1 0
11 12 2 0
12 13 1 0
13 14 2 0
7 11 1 0
14 8 1 0
15 16 2 0
16 17 1 0
17 18 2 0
2 15 1 0
18 3 1 0
4 19 2 0
4 5 1 0
5 6 1 0
5 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
8 9 1 0
9 10 2 0
17 25 1 0
25 26 1 0
16 27 1 0
27 28 1 0
13 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 392.46Molecular Weight (Monoisotopic): 392.1848AlogP: 2.86#Rotatable Bonds: 5Polar Surface Area: 82.61Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.15CX LogP: 1.64CX LogD: 0.81Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.42Np Likeness Score: -0.65
References 1. Talukdar A, Kundu B, Sarkar D, Goon S, Mondal MA.. (2022) Topoisomerase I inhibitors: Challenges, progress and the road ahead., 236 [PMID:35413618 ] [10.1016/j.ejmech.2022.114304 ]