The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3,4-dimethoxyphenyl)-5-(4-(dipentylamino)butoxy)-3,7-dimethoxy-4H-chromen-4-one ID: ALA5178716
PubChem CID: 168276263
Max Phase: Preclinical
Molecular Formula: C33H47NO7
Molecular Weight: 569.74
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCN(CCCCC)CCCCOc1cc(OC)cc2oc(-c3ccc(OC)c(OC)c3)c(OC)c(=O)c12
Standard InChI: InChI=1S/C33H47NO7/c1-7-9-11-17-34(18-12-10-8-2)19-13-14-20-40-28-22-25(36-3)23-29-30(28)31(35)33(39-6)32(41-29)24-15-16-26(37-4)27(21-24)38-5/h15-16,21-23H,7-14,17-20H2,1-6H3
Standard InChI Key: OXVOLGMJZSLJFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
-2.1429 3.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4285 3.7126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7140 3.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7140 2.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0021 2.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0021 1.2387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7123 0.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7123 0.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4268 -0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4268 -1.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1412 -1.6485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8557 -1.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5701 -1.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2846 -1.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9990 -1.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7135 -1.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1412 -2.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8557 -2.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8557 -3.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5701 -4.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5701 -4.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7120 2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4265 2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4265 1.2380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1410 2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8554 2.0630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5699 2.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1410 3.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8554 3.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5729 3.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2846 3.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9990 3.3026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7135 3.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2846 4.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9974 4.9485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7119 4.5359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5683 4.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8554 4.5380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4265 3.7129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7120 3.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0002 3.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
11 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
5 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
25 28 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 1 0
31 34 1 0
34 35 1 0
35 36 1 0
34 37 2 0
37 38 1 0
38 29 2 0
28 39 1 0
40 39 1 0
22 40 2 0
40 41 1 0
41 3 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.74Molecular Weight (Monoisotopic): 569.3353AlogP: 7.34#Rotatable Bonds: 19Polar Surface Area: 79.60Molecular Species: BASEHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.12CX LogP: 6.34CX LogD: 3.68Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.14Np Likeness Score: 0.28
References 1. Rangel VM, Gu L, Chen G, Chen QH, Xue L.. (2022) 5-Substituted 3, 3', 4', 7-tetramethoxyflavonoids - A novel class of potent DNA triplex specific binding ligands., 61 [PMID:35143982 ] [10.1016/j.bmcl.2022.128608 ]