N-cyclohexyl-2-nitro-4-((trifluoromethyl)sulfonyl)aniline

ID: ALA5178944

PubChem CID: 168271776

Max Phase: Preclinical

Molecular Formula: C13H15F3N2O4S

Molecular Weight: 352.33

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1cc(S(=O)(=O)C(F)(F)F)ccc1NC1CCCCC1

Standard InChI:  InChI=1S/C13H15F3N2O4S/c14-13(15,16)23(21,22)10-6-7-11(12(8-10)18(19)20)17-9-4-2-1-3-5-9/h6-9,17H,1-5H2

Standard InChI Key:  MPYBNKALYKEDCU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    1.0732    1.8015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3587    1.3889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3556    1.8015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3587    0.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0707    0.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0707   -0.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851   -1.0857    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.1968   -1.8015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3718   -1.8015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3605   -1.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558   -0.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558    0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0703    0.5641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7847    0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4995    0.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2141    0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2141   -0.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4995   -1.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7847   -0.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4996   -0.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4996    0.1517    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2141   -1.0857    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2141   -0.2607    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  2  4  1  0
  5  4  1  0
  6  5  2  0
  6  7  1  0
  7  8  2  0
  7  9  2  0
 10  6  1  0
 11 10  2  0
 12 11  1  0
  4 12  2  0
 13 12  1  0
 14 13  1  0
 14 15  1  0
 16 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 14  1  0
  7 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
M  CHG  2   1  -1   2   1
M  END

Alternative Forms

  1. Parent:

    ALA5178944

    ---

Associated Targets(Human)

WNK1 Tchem Serine/threonine-protein kinase WNK1 (297 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 352.33Molecular Weight (Monoisotopic): 352.0705AlogP: 3.63#Rotatable Bonds: 4
Polar Surface Area: 89.31Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.11CX Basic pKa: CX LogP: 4.78CX LogD: 4.78
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.66Np Likeness Score: -1.63

References

1. Rodriguez M, Kannangara A, Chlebowicz J, Akella R, He H, Tambar UK, Goldsmith EJ..  (2022)  Synthesis and Structural Characterization of Novel Trihalo-sulfone Inhibitors of WNK1.,  13  (10.0): [PMID:36262391] [10.1021/acsmedchemlett.2c00216]

Source