The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Chermebilaene A ID: ALA5179107
PubChem CID: 168271779
Max Phase: Preclinical
Molecular Formula: C35H56O4
Molecular Weight: 540.83
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@H]1[C@H](OC(C)=O)C[C@H](C)[C@@]12CC=C(C)[C@@H](OC(=O)CCCCCCC/C=C\C/C=C\CCCCC)C2
Standard InChI: InChI=1S/C35H56O4/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-33(37)39-32-26-35(24-23-28(32)4)29(5)25-31(38-30(6)36)34(35)27(2)3/h11-12,14-15,23,29,31-32,34H,2,7-10,13,16-22,24-26H2,1,3-6H3/b12-11-,15-14-/t29-,31+,32-,34-,35-/m0/s1
Standard InChI Key: VNFKNGLLVFNNAJ-CZLXEKCWSA-N
Molfile:
RDKit 2D
39 40 0 0 0 0 0 0 0 0999 V2000
-6.0431 0.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3286 1.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0431 0.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3284 -0.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3284 -1.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6137 -1.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8991 -1.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1845 -1.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4698 -1.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7551 -1.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0405 -1.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3259 -1.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3887 -1.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1033 -1.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8180 -1.1549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1033 -2.3927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8180 -0.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6140 0.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8993 1.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1847 0.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4700 1.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1034 0.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1034 0.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8180 1.3206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5327 0.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5327 0.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3887 -0.3297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8282 1.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6520 1.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8654 0.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1736 0.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4156 2.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6625 0.6247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1736 -0.4361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8882 -0.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4590 -0.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2460 1.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0431 0.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0324 2.0053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
17 15 1 6
2 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 17 1 0
23 22 2 0
24 23 1 0
25 24 1 0
17 26 1 0
25 26 1 1
22 27 1 0
25 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
25 31 1 0
28 32 1 1
30 33 1 1
31 34 1 6
34 35 2 0
34 36 1 0
33 37 1 0
37 38 1 0
37 39 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.83Molecular Weight (Monoisotopic): 540.4179AlogP: 9.60#Rotatable Bonds: 17Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 9.51CX LogD: 9.51Aromatic Rings: ┄Heavy Atoms: 39QED Weighted: 0.10Np Likeness Score: 2.03
References 1. Gozari M, Alborz M, El-Seedi HR, Jassbi AR.. (2021) Chemistry, biosynthesis and biological activity of terpenoids and meroterpenoids in bacteria and fungi isolated from different marine habitats., 210 [PMID:33160760 ] [10.1016/j.ejmech.2020.112957 ]