Chermebilaene A

ID: ALA5179107

PubChem CID: 168271779

Max Phase: Preclinical

Molecular Formula: C35H56O4

Molecular Weight: 540.83

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(C)[C@H]1[C@H](OC(C)=O)C[C@H](C)[C@@]12CC=C(C)[C@@H](OC(=O)CCCCCCC/C=C\C/C=C\CCCCC)C2

Standard InChI:  InChI=1S/C35H56O4/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-33(37)39-32-26-35(24-23-28(32)4)29(5)25-31(38-30(6)36)34(35)27(2)3/h11-12,14-15,23,29,31-32,34H,2,7-10,13,16-22,24-26H2,1,3-6H3/b12-11-,15-14-/t29-,31+,32-,34-,35-/m0/s1

Standard InChI Key:  VNFKNGLLVFNNAJ-CZLXEKCWSA-N

Molfile:  

 
     RDKit          2D

 39 40  0  0  0  0  0  0  0  0999 V2000
   -6.0431    0.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3286    1.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0431    0.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3284   -0.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3284   -1.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6137   -1.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8991   -1.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1845   -1.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4698   -1.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7551   -1.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0405   -1.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3259   -1.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3887   -1.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1033   -1.5675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8180   -1.1549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1033   -2.3927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8180   -0.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6140    0.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8993    1.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1847    0.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4700    1.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1034    0.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1034    0.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8180    1.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5327    0.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5327    0.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3887   -0.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8282    1.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6520    1.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8654    0.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1736    0.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4156    2.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6625    0.6247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1736   -0.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8882   -0.8487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4590   -0.8487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2460    1.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0431    0.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0324    2.0053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 17 15  1  6
  2 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 17  1  0
 23 22  2  0
 24 23  1  0
 25 24  1  0
 17 26  1  0
 25 26  1  1
 22 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 25 31  1  0
 28 32  1  1
 30 33  1  1
 31 34  1  6
 34 35  2  0
 34 36  1  0
 33 37  1  0
 37 38  1  0
 37 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5179107

    ---

Associated Targets(non-human)

Ceratobasidium cornigerum (8 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Edwardsiella tarda (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.83Molecular Weight (Monoisotopic): 540.4179AlogP: 9.60#Rotatable Bonds: 17
Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 9.51CX LogD: 9.51
Aromatic Rings: Heavy Atoms: 39QED Weighted: 0.10Np Likeness Score: 2.03

References

1. Gozari M, Alborz M, El-Seedi HR, Jassbi AR..  (2021)  Chemistry, biosynthesis and biological activity of terpenoids and meroterpenoids in bacteria and fungi isolated from different marine habitats.,  210  [PMID:33160760] [10.1016/j.ejmech.2020.112957]

Source