The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-fluorophenyl)amino)-N-(4-(3-(2-((4-(trifluoromethoxy)phenyl)amino)pyridin-4-yl)-1,2,4-oxadiazol-5-yl)phenyl)acetamide ID: ALA5179502
PubChem CID: 163322013
Max Phase: Preclinical
Molecular Formula: C28H20F4N6O3
Molecular Weight: 564.50
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNc1ccc(F)cc1)Nc1ccc(-c2nc(-c3ccnc(Nc4ccc(OC(F)(F)F)cc4)c3)no2)cc1
Standard InChI: InChI=1S/C28H20F4N6O3/c29-19-3-7-20(8-4-19)34-16-25(39)36-22-5-1-17(2-6-22)27-37-26(38-41-27)18-13-14-33-24(15-18)35-21-9-11-23(12-10-21)40-28(30,31)32/h1-15,34H,16H2,(H,33,35)(H,36,39)
Standard InChI Key: QVBGPENLPOKABU-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
-2.8565 -4.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1419 -4.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4299 -4.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4299 -5.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1400 -5.8213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 -5.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7153 -5.8221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0007 -5.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0005 -4.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7123 -4.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4270 -4.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4287 -5.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7169 -5.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1418 -4.1737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1418 -3.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 -2.9359 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4270 -2.9359 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1418 -2.5233 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.1419 -3.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 -2.9346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6710 -2.1131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8695 -2.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5374 -2.7921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4570 -1.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8694 -0.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4574 0.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6319 0.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2200 -0.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6282 -1.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2194 0.8238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6319 1.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2194 2.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6319 2.9676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2194 3.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6317 4.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2197 5.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6056 5.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0175 4.3990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6092 3.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4571 1.5384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0182 5.8239 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
15 18 1 0
19 2 1 0
19 20 2 0
20 21 1 0
21 22 1 0
23 22 2 0
19 23 1 0
24 22 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
27 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
35 34 2 0
36 35 1 0
37 36 2 0
38 37 1 0
39 38 2 0
34 39 1 0
31 40 2 0
37 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 564.50Molecular Weight (Monoisotopic): 564.1533AlogP: 6.63#Rotatable Bonds: 9Polar Surface Area: 114.20Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.87CX Basic pKa: 3.44CX LogP: 7.19CX LogD: 7.19Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.17Np Likeness Score: -1.73
References 1. Liu T, Chen S, Du J, Xing S, Li R, Li Z.. (2022) Design, synthesis, and biological evaluation of novel (4-(1,2,4-oxadiazol-5-yl)phenyl)-2-aminoacetamide derivatives as multifunctional agents for the treatment of Alzheimer's disease., 227 [PMID:34752955 ] [10.1016/j.ejmech.2021.113973 ]