The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(trans)-(S)-4-(4-chloro-3-(hydroxymethyl)phenoxy)-N-methyl-N-(3-methyl-4-((3-methylpiperazin-1-yl)methyl)phenyl)cyclohexanecarboxamide ID: ALA5179573
PubChem CID: 89723534
Max Phase: Preclinical
Molecular Formula: C28H38ClN3O3
Molecular Weight: 500.08
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(N(C)C(=O)[C@H]2CC[C@H](Oc3ccc(Cl)c(CO)c3)CC2)ccc1CN1CCN[C@@H](C)C1
Standard InChI: InChI=1S/C28H38ClN3O3/c1-19-14-24(7-4-22(19)17-32-13-12-30-20(2)16-32)31(3)28(34)21-5-8-25(9-6-21)35-26-10-11-27(29)23(15-26)18-33/h4,7,10-11,14-15,20-21,25,30,33H,5-6,8-9,12-13,16-18H2,1-3H3/t20-,21-,25-/m0/s1
Standard InChI Key: APUHSFRBOLQWNH-WATLYSKOSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-3.9274 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2130 1.8570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4985 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4985 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2130 0.2070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9274 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2130 -0.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4987 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7843 -0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0726 -1.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0726 -1.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7825 -2.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4987 -1.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2130 -2.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -2.2670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 -1.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 -1.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 0.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 0.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 -0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 1.4442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0702 1.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0704 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7828 3.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4973 2.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4989 1.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7875 1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 -2.2670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -3.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7842 1.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2115 3.0918 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.2131 1.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9274 1.8587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
13 14 1 0
11 15 1 0
15 16 1 0
17 16 1 1
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
17 22 1 0
20 23 1 6
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
16 30 2 0
15 31 1 0
3 32 1 1
27 33 1 0
28 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.08Molecular Weight (Monoisotopic): 499.2602AlogP: 4.54#Rotatable Bonds: 7Polar Surface Area: 65.04Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.35CX LogP: 4.31CX LogD: 2.37Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.59Np Likeness Score: -1.00
References 1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M.. (2022) Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure., 59 [PMID:35051575 ] [10.1016/j.bmcl.2022.128554 ]