7-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-3-(1-ethylpiperidin-4-yl)-5-fluorocinnoline

ID: ALA5179682

PubChem CID: 146585458

Max Phase: Preclinical

Molecular Formula: C23H25FN6

Molecular Weight: 404.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN1CCC(c2cc3c(F)cc(-c4cc(C)c5nc(C)cn5n4)cc3nn2)CC1

Standard InChI:  InChI=1S/C23H25FN6/c1-4-29-7-5-16(6-8-29)20-12-18-19(24)10-17(11-22(18)27-26-20)21-9-14(2)23-25-15(3)13-30(23)28-21/h9-13,16H,4-8H2,1-3H3

Standard InChI Key:  APXTULSKNLWAOS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   -1.7564    0.0032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0418    0.4155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3300    0.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3300   -0.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0400   -1.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7564   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3826    0.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0976    0.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0994   -0.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3877   -1.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8122    0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8124    1.2398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5253    1.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2401    1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2418    0.4166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5299    0.0002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4711   -1.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4711   -2.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1857   -2.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9003   -2.0630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9003   -1.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1857   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0230    0.1644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0205    1.4930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5044    0.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3296    0.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3877   -2.0609    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6150   -2.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3296   -2.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5253    2.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  4 10  2  0
 11  8  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  1  0
 11 16  2  0
 16 15  1  0
 17  6  1  0
 17 18  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 17 22  1  0
 22 21  1  0
 15 23  1  0
 14 24  2  0
 24 25  1  0
 25 23  2  0
 25 26  1  0
 10 27  1  0
 20 28  1  0
 28 29  1  0
 13 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5179682

    ---

Associated Targets(Human)

HTT Tchem Huntingtin (19182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.49Molecular Weight (Monoisotopic): 404.2125AlogP: 4.29#Rotatable Bonds: 3
Polar Surface Area: 59.21Molecular Species: BASEHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.97CX LogP: 3.63CX LogD: 2.05
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -1.68

References

1. Wang W, He S, Dong G, Sheng C..  (2022)  Nucleic-Acid-Based Targeted Degradation in Drug Discovery.,  65  (15.0): [PMID:35916496] [10.1021/acs.jmedchem.2c00875]
2. Ahamad S, Bhat SA..  (2022)  The Emerging Landscape of Small-Molecule Therapeutics for the Treatment of Huntington's Disease.,  65  (24.0): [PMID:36490325] [10.1021/acs.jmedchem.2c00799]

Source