The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Alstomairine B ID: ALA5179840
PubChem CID: 168271328
Max Phase: Preclinical
Molecular Formula: C22H27N2O4+
Molecular Weight: 383.47
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C2Nc3c(OC)cccc3[C@]23CC[N+]2(C)C[C@H](C(C)=O)[C@H]1C[C@H]32
Standard InChI: InChI=1S/C22H26N2O4/c1-12(25)14-11-24(2)9-8-22-15-6-5-7-16(27-3)19(15)23-20(22)18(21(26)28-4)13(14)10-17(22)24/h5-7,13-14,17H,8-11H2,1-4H3/p+1/t13-,14-,17-,22+,24?/m1/s1
Standard InChI Key: BBEMTBXCKZOCSO-VVEHASEJSA-O
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
-2.7517 0.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0372 0.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3251 0.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3251 -0.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0354 -1.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7517 -0.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5404 -1.0765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0553 -0.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5402 0.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2045 1.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6161 1.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1011 0.4310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7653 -0.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7517 0.4310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3391 1.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5137 1.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0331 1.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2078 1.7271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2784 2.3331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8412 1.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8158 0.0183 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.4181 1.8096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0354 -2.0587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7501 -2.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1780 -1.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0032 -1.0376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4159 -1.7523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7653 -1.7523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7517 1.8604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5648 2.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
8 7 1 0
3 9 1 0
9 8 1 0
9 10 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 2 0
15 14 1 0
12 16 1 0
16 15 1 6
16 17 1 0
10 18 1 0
18 17 1 0
18 19 1 0
9 20 1 6
20 19 1 0
12 21 1 1
10 22 1 1
5 23 1 0
23 24 1 0
13 25 1 0
25 26 1 0
26 27 1 0
25 28 2 0
15 29 2 0
18 30 1 0
M CHG 1 18 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 383.47Molecular Weight (Monoisotopic): 383.1965AlogP: 2.24#Rotatable Bonds: 3Polar Surface Area: 64.63Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.99CX Basic pKa: ┄CX LogP: -3.16CX LogD: -3.16Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.64Np Likeness Score: 1.82