The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl (3S)-1-(1-(3,4-difluorobenzyl)-3-oxo-1,3-dihydroisobenzofuran-5-yl)pyrrolidine-3-carboxylate ID: ALA5179955
PubChem CID: 168273312
Max Phase: Preclinical
Molecular Formula: C21H19F2NO4
Molecular Weight: 387.38
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H]1CCN(c2ccc3c(c2)C(=O)OC3Cc2ccc(F)c(F)c2)C1
Standard InChI: InChI=1S/C21H19F2NO4/c1-27-20(25)13-6-7-24(11-13)14-3-4-15-16(10-14)21(26)28-19(15)9-12-2-5-17(22)18(23)8-12/h2-5,8,10,13,19H,6-7,9,11H2,1H3/t13-,19?/m0/s1
Standard InChI Key: MBJNOZVIDSTPHW-YTJLLHSVSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
-0.7752 -0.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0607 0.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6538 -0.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6538 -1.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4384 -1.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9234 -0.7737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4384 -0.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6934 0.6783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5004 0.8499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7554 1.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5624 1.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8173 2.5908 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.1145 1.1930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9215 1.3645 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8595 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0525 0.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6934 -2.2258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0607 -1.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7752 -1.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4897 -1.5988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5759 -2.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3829 -2.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7955 -1.8763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6160 -1.7901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1010 -2.4575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9215 -2.3713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9516 -1.0364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2434 -1.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
4 5 1 0
6 5 1 0
3 7 1 0
7 6 1 0
7 8 1 0
8 9 1 0
10 9 2 0
11 10 1 0
11 12 1 0
13 11 2 0
13 14 1 0
15 13 1 0
16 15 2 0
9 16 1 0
5 17 2 0
18 4 1 0
19 18 2 0
1 19 1 0
20 19 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 6
24 25 1 0
25 26 1 0
24 27 2 0
23 28 1 0
28 20 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 387.38Molecular Weight (Monoisotopic): 387.1282AlogP: 3.42#Rotatable Bonds: 4Polar Surface Area: 55.84Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.43CX LogP: 3.92CX LogD: 3.92Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.75Np Likeness Score: -0.68
References 1. Liu K, Zhou S, Zhou J, Bo R, Wang X, Xu T, Yuan Y, Xu B.. (2022) Discovery of 3, 6-disubstituted isobenzofuran-1(3H)-ones as novel inhibitors of monoamine oxidases., 67 [PMID:35472505 ] [10.1016/j.bmcl.2022.128748 ]