Methyl (3S)-1-(1-(3,4-difluorobenzyl)-3-oxo-1,3-dihydroisobenzofuran-5-yl)pyrrolidine-3-carboxylate

ID: ALA5179955

PubChem CID: 168273312

Max Phase: Preclinical

Molecular Formula: C21H19F2NO4

Molecular Weight: 387.38

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H]1CCN(c2ccc3c(c2)C(=O)OC3Cc2ccc(F)c(F)c2)C1

Standard InChI:  InChI=1S/C21H19F2NO4/c1-27-20(25)13-6-7-24(11-13)14-3-4-15-16(10-14)21(26)28-19(15)9-12-2-5-17(22)18(23)8-12/h2-5,8,10,13,19H,6-7,9,11H2,1H3/t13-,19?/m0/s1

Standard InChI Key:  MBJNOZVIDSTPHW-YTJLLHSVSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -0.7752   -0.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0607    0.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6538   -0.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6538   -1.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4384   -1.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9234   -0.7737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4384   -0.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6934    0.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5004    0.8499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7554    1.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5624    1.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8173    2.5908    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.1145    1.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9215    1.3645    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8595    0.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0525    0.2368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6934   -2.2258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0607   -1.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7752   -1.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4897   -1.5988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5759   -2.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3829   -2.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7955   -1.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6160   -1.7901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1010   -2.4575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9215   -2.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9516   -1.0364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2434   -1.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  4  5  1  0
  6  5  1  0
  3  7  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 11 12  1  0
 13 11  2  0
 13 14  1  0
 15 13  1  0
 16 15  2  0
  9 16  1  0
  5 17  2  0
 18  4  1  0
 19 18  2  0
  1 19  1  0
 20 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  6
 24 25  1  0
 25 26  1  0
 24 27  2  0
 23 28  1  0
 28 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5179955

    ---

Associated Targets(non-human)

Maob Monoamine oxidase B (2209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.38Molecular Weight (Monoisotopic): 387.1282AlogP: 3.42#Rotatable Bonds: 4
Polar Surface Area: 55.84Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.43CX LogP: 3.92CX LogD: 3.92
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.75Np Likeness Score: -0.68

References

1. Liu K, Zhou S, Zhou J, Bo R, Wang X, Xu T, Yuan Y, Xu B..  (2022)  Discovery of 3, 6-disubstituted isobenzofuran-1(3H)-ones as novel inhibitors of monoamine oxidases.,  67  [PMID:35472505] [10.1016/j.bmcl.2022.128748]

Source