Methyl (3R)-1-(1-(4-(trifluoromethyl)benzyl)-3-oxo-1,3-dihydroisobenzofuran-5-yl)pyrrolidine-3-carboxylate

ID: ALA5180787

PubChem CID: 168271454

Max Phase: Preclinical

Molecular Formula: C22H20F3NO4

Molecular Weight: 419.40

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@@H]1CCN(c2ccc3c(c2)C(=O)OC3Cc2ccc(C(F)(F)F)cc2)C1

Standard InChI:  InChI=1S/C22H20F3NO4/c1-29-20(27)14-8-9-26(12-14)16-6-7-17-18(11-16)21(28)30-19(17)10-13-2-4-15(5-3-13)22(23,24)25/h2-7,11,14,19H,8-10,12H2,1H3/t14-,19?/m1/s1

Standard InChI Key:  LTJATBVCYRIZGX-MJTSIZKDSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -1.1786   -0.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1786   -0.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8931   -1.3778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6467   -1.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1988   -1.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0192   -1.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5042   -2.2366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3247   -2.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3548   -0.8155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7862   -2.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9793   -2.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4641   -1.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2503   -0.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0349   -1.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2898   -2.0050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5198   -0.5528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0349    0.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2898    0.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0968    1.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6488    0.4575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4558    0.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7108    1.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5177    1.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3247    1.7567    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.0698    0.9721    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.7726    2.3699    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1587    2.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3517    1.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2503   -0.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4641    0.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  5  6  1  1
  6  7  1  0
  7  8  1  0
  6  9  2  0
 10  5  1  0
 11 10  1  0
  3 11  1  0
  2 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 16 14  1  0
 17 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
 22 27  2  0
 27 28  1  0
 28 19  2  0
 29 17  1  0
 13 29  2  0
 29 30  1  0
 30  1  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5180787

    ---

Associated Targets(non-human)

Maob Monoamine oxidase B (2209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.40Molecular Weight (Monoisotopic): 419.1344AlogP: 4.16#Rotatable Bonds: 4
Polar Surface Area: 55.84Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.43CX LogP: 4.52CX LogD: 4.52
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.70Np Likeness Score: -0.46

References

1. Liu K, Zhou S, Zhou J, Bo R, Wang X, Xu T, Yuan Y, Xu B..  (2022)  Discovery of 3, 6-disubstituted isobenzofuran-1(3H)-ones as novel inhibitors of monoamine oxidases.,  67  [PMID:35472505] [10.1016/j.bmcl.2022.128748]

Source