The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl ((S)-2-(2-((E)-3-(4-hydroxy-3-methoxyphenyl)acrylamido)acetamido)-4-phenylbutanoyl)-D-glutamate ID: ALA5180997
PubChem CID: 168276339
Max Phase: Preclinical
Molecular Formula: C31H39N3O9
Molecular Weight: 597.67
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CC[C@@H](NC(=O)[C@H](CCc1ccccc1)NC(=O)CNC(=O)/C=C/c1ccc(O)c(OC)c1)C(=O)OCC
Standard InChI: InChI=1S/C31H39N3O9/c1-4-42-29(38)18-15-24(31(40)43-5-2)34-30(39)23(14-11-21-9-7-6-8-10-21)33-28(37)20-32-27(36)17-13-22-12-16-25(35)26(19-22)41-3/h6-10,12-13,16-17,19,23-24,35H,4-5,11,14-15,18,20H2,1-3H3,(H,32,36)(H,33,37)(H,34,39)/b17-13+/t23-,24+/m0/s1
Standard InChI Key: UVQGKTDIDWJTNO-NUWZUGDKSA-N
Molfile:
RDKit 2D
43 44 0 0 0 0 0 0 0 0999 V2000
-2.8792 -0.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1648 -0.3754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8792 -1.6132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5939 -0.3753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3087 -0.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0234 -0.3753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7382 -0.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4504 -0.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4504 0.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7400 0.8617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0234 0.4535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1651 0.8624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.1651 -0.7883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.1651 -1.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4500 -0.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7353 -0.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0207 -0.7881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7353 0.4498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6940 -0.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4087 -0.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6940 0.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1233 -0.3754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4087 -1.6133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8381 -0.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5528 -0.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2674 -0.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9822 -0.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6969 -0.7881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4115 -0.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8381 -1.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5528 -2.0260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1233 -2.0260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5528 -2.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8854 -3.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1651 -0.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9822 0.4498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4087 0.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4087 1.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6940 2.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6948 2.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4097 3.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1217 2.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1264 2.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
4 5 2 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
9 12 1 0
8 13 1 0
13 14 1 0
2 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
19 21 1 1
20 22 1 0
20 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
24 30 1 6
30 31 1 0
30 32 2 0
31 33 1 0
34 33 1 0
35 29 1 0
27 36 2 0
37 21 1 0
37 38 1 0
39 38 2 0
40 39 1 0
41 40 2 0
42 41 1 0
43 42 2 0
38 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.67Molecular Weight (Monoisotopic): 597.2686AlogP: 2.04#Rotatable Bonds: 17Polar Surface Area: 169.36Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.88CX Basic pKa: ┄CX LogP: 2.25CX LogD: 2.25Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.16Np Likeness Score: 0.01