The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-oxo-3-phenyl-1-(((S)-5-phenyl-1-(phenylsulfonyl)pent-1-en-3-yl)amino)propan-2-yl)-4-propylpiperazine-1-carboxamide ID: ALA5181012
PubChem CID: 168276350
Max Phase: Preclinical
Molecular Formula: C34H42N4O4S
Molecular Weight: 602.80
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCN1CCN(C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](/C=C/S(=O)(=O)c2ccccc2)CCc2ccccc2)CC1
Standard InChI: InChI=1S/C34H42N4O4S/c1-2-21-37-22-24-38(25-23-37)34(40)36-32(27-29-14-8-4-9-15-29)33(39)35-30(19-18-28-12-6-3-7-13-28)20-26-43(41,42)31-16-10-5-11-17-31/h3-17,20,26,30,32H,2,18-19,21-25,27H2,1H3,(H,35,39)(H,36,40)/b26-20+/t30-,32-/m0/s1
Standard InChI Key: DSOSFLUNDAOFRM-QGVAVTBLSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
1.0719 -0.8245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7864 -0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7864 0.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3573 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 0.4133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5010 0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5010 -0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2157 -0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9304 -0.8246 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.6451 -0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6453 0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3582 0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0731 0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0747 -0.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3628 -0.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5171 -1.5406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3422 -1.5406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3573 -1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0720 -0.4119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7867 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5014 -0.4119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7867 -1.6496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2161 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9307 -0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9307 0.4133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2161 0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5014 0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6454 0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7842 -2.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7842 -2.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0739 -3.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -2.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5010 1.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2188 2.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2140 2.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5021 3.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7865 2.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7872 2.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3601 0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0747 0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 1
1 4 1 0
4 5 1 0
4 6 2 0
3 7 1 0
2 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
10 17 2 0
10 18 2 0
5 19 1 6
5 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
24 22 1 0
25 24 1 0
26 25 1 0
27 26 1 0
28 27 1 0
22 28 1 0
26 29 1 0
19 30 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
30 35 1 0
7 36 1 0
36 37 1 0
37 38 2 0
38 39 1 0
40 36 2 0
41 40 1 0
39 41 2 0
29 42 1 0
42 43 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.80Molecular Weight (Monoisotopic): 602.2927AlogP: 4.44#Rotatable Bonds: 13Polar Surface Area: 98.82Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.97CX Basic pKa: 7.59CX LogP: 4.84CX LogD: 4.43Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.30Np Likeness Score: -0.63