The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((2-((3-aminophenyl)amino)pyrimidin-5-yl)carbamoyl)-4-methylphenyl)-4'-methyl-[1,1'-biphenyl]-3-carboxamide ID: ALA5181082
PubChem CID: 168275986
Max Phase: Preclinical
Molecular Formula: C32H28N6O2
Molecular Weight: 528.62
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2cccc(C(=O)Nc3ccc(C)c(C(=O)Nc4cnc(Nc5cccc(N)c5)nc4)c3)c2)cc1
Standard InChI: InChI=1S/C32H28N6O2/c1-20-9-12-22(13-10-20)23-5-3-6-24(15-23)30(39)36-27-14-11-21(2)29(17-27)31(40)37-28-18-34-32(35-19-28)38-26-8-4-7-25(33)16-26/h3-19H,33H2,1-2H3,(H,36,39)(H,37,40)(H,34,35,38)
Standard InChI Key: MBLYISXCENKRLF-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
-6.4249 2.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7133 2.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9972 2.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9972 1.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7097 1.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4249 1.4372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7097 0.2020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2856 2.6749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5698 2.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8561 2.6746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1454 2.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1454 1.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8542 1.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5698 1.4376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4297 1.0270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7121 1.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0005 1.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7114 1.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4279 1.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4279 0.2010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7151 -0.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0005 0.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7151 -1.0360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4309 -1.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4309 -2.2703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 -1.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1430 -0.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8569 0.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5731 -0.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5763 -1.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8604 -1.4477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2835 -1.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2833 -2.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9982 -2.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7099 -2.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7044 -1.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9927 -1.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7114 2.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7121 2.2612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4249 -2.6762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
3 8 1 0
8 9 1 0
10 9 2 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 2 0
9 14 1 0
12 15 1 0
15 16 1 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
21 23 1 0
23 24 1 0
24 25 2 0
24 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
30 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
18 38 1 0
16 39 2 0
35 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.62Molecular Weight (Monoisotopic): 528.2274AlogP: 6.59#Rotatable Bonds: 7Polar Surface Area: 122.03Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.66CX Basic pKa: 4.38CX LogP: 6.20CX LogD: 6.20Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: -1.40
References 1. Fu T, Zuo Y, Zhong Z, Chen X, Pan Z.. (2022) Discovery of selective irreversible inhibitors of B-Lymphoid tyrosine kinase (BLK)., 229 [PMID:34952433 ] [10.1016/j.ejmech.2021.114051 ]