N-(3-((2-((3-aminophenyl)amino)pyrimidin-5-yl)carbamoyl)-4-methylphenyl)-4'-methyl-[1,1'-biphenyl]-3-carboxamide

ID: ALA5181082

PubChem CID: 168275986

Max Phase: Preclinical

Molecular Formula: C32H28N6O2

Molecular Weight: 528.62

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cccc(C(=O)Nc3ccc(C)c(C(=O)Nc4cnc(Nc5cccc(N)c5)nc4)c3)c2)cc1

Standard InChI:  InChI=1S/C32H28N6O2/c1-20-9-12-22(13-10-20)23-5-3-6-24(15-23)30(39)36-27-14-11-21(2)29(17-27)31(40)37-28-18-34-32(35-19-28)38-26-8-4-7-25(33)16-26/h3-19H,33H2,1-2H3,(H,36,39)(H,37,40)(H,34,35,38)

Standard InChI Key:  MBLYISXCENKRLF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   -6.4249    2.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7133    2.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9972    2.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9972    1.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7097    1.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4249    1.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7097    0.2020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2856    2.6749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5698    2.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8561    2.6746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1454    2.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1454    1.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8542    1.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5698    1.4376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4297    1.0270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7121    1.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005    1.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7114    1.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4279    1.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4279    0.2010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7151   -0.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005    0.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7151   -1.0360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4309   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4309   -2.2703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1425   -1.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1430   -0.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8569    0.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5731   -0.2138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5763   -1.0376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8604   -1.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2835   -1.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2833   -2.2698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9982   -2.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7099   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7044   -1.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9927   -1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7114    2.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7121    2.2612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4249   -2.6762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  3  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 30 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 18 38  1  0
 16 39  2  0
 35 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5181082

    ---

Associated Targets(Human)

BLK Tchem Tyrosine-protein kinase BLK (2498 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.62Molecular Weight (Monoisotopic): 528.2274AlogP: 6.59#Rotatable Bonds: 7
Polar Surface Area: 122.03Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.66CX Basic pKa: 4.38CX LogP: 6.20CX LogD: 6.20
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: -1.40

References

1. Fu T, Zuo Y, Zhong Z, Chen X, Pan Z..  (2022)  Discovery of selective irreversible inhibitors of B-Lymphoid tyrosine kinase (BLK).,  229  [PMID:34952433] [10.1016/j.ejmech.2021.114051]

Source