The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(trans)-(S)-3-(4-(methyl(3-methyl-4-((3-methylpiperazin-1-yl)methyl)phenyl)carbamoyl)cyclohexyloxy)benzoic acid ID: ALA5181246
PubChem CID: 168277170
Max Phase: Preclinical
Molecular Formula: C28H37N3O4
Molecular Weight: 479.62
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(N(C)C(=O)[C@H]2CC[C@H](Oc3cccc(C(=O)O)c3)CC2)ccc1CN1CCN[C@@H](C)C1
Standard InChI: InChI=1S/C28H37N3O4/c1-19-15-24(10-7-23(19)18-31-14-13-29-20(2)17-31)30(3)27(32)21-8-11-25(12-9-21)35-26-6-4-5-22(16-26)28(33)34/h4-7,10,15-16,20-21,25,29H,8-9,11-14,17-18H2,1-3H3,(H,33,34)/t20-,21-,25-/m0/s1
Standard InChI Key: AQHHGQIJXHJQER-WATLYSKOSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-3.9274 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2130 1.8570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4985 1.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4985 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2130 0.2070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9274 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2130 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4987 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7843 -0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0726 -1.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0726 -1.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7825 -2.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4987 -1.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2130 -2.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -2.2671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 -1.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 -1.0300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 0.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 0.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 -0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 1.4442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0702 1.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0704 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7828 3.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4973 2.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4989 1.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7875 1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0701 -2.2671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -3.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7842 1.8569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2131 1.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9274 1.8587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2131 0.6215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
13 14 1 0
11 15 1 0
15 16 1 0
17 16 1 1
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
17 22 1 0
20 23 1 6
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
16 30 2 0
15 31 1 0
3 32 1 1
28 33 1 0
33 34 1 0
33 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.62Molecular Weight (Monoisotopic): 479.2784AlogP: 4.09#Rotatable Bonds: 7Polar Surface Area: 82.11Molecular Species: ZWITTERIONHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.77CX Basic pKa: 9.35CX LogP: 1.63CX LogD: 1.63Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.62Np Likeness Score: -0.97
References 1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M.. (2022) Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure., 59 [PMID:35051575 ] [10.1016/j.bmcl.2022.128554 ]