butyl 3-(4-carbamoylphenyl)-5-isobutylthiophen-2-ylsulfonylcarbamate

ID: ALA518157

PubChem CID: 44567709

Max Phase: Preclinical

Molecular Formula: C20H26N2O5S2

Molecular Weight: 438.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(C(N)=O)cc1

Standard InChI:  InChI=1S/C20H26N2O5S2/c1-4-5-10-27-20(24)22-29(25,26)19-17(12-16(28-19)11-13(2)3)14-6-8-15(9-7-14)18(21)23/h6-9,12-13H,4-5,10-11H2,1-3H3,(H2,21,23)(H,22,24)

Standard InChI Key:  OYEOYUQRRQBSEJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 30  0  0  0  0  0  0  0  0999 V2000
    2.4984    0.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7815   -0.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7744   -1.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4861   -1.5629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2063   -1.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2098   -0.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4853   -2.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8147   -2.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0643   -3.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8893   -3.6618    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.1494   -2.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9358   -2.6293    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.7170   -2.3706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1902   -3.4140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6832   -1.8439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3332   -2.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1675   -3.7271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1178   -2.6600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7845   -4.2748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6187   -5.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2357   -5.6306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0700   -6.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5748   -4.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9053   -5.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4158   -5.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7251   -5.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5021    0.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2193    1.3171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7904    1.3265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11  7  2  0
  4  7  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 12 15  2  0
 13 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
  1  2  2  0
 19 20  1  0
 20 21  1  0
  2  3  1  0
 21 22  1  0
  9 23  1  0
  3  4  2  0
 23 24  1  0
 24 25  1  0
  4  5  1  0
 24 26  1  0
  5  6  2  0
  6  1  1  0
 27 28  1  0
 27 29  2  0
  1 27  1  0
M  END

Associated Targets(non-human)

Agtr1 Type-1A angiotensin II receptor (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGTR1 Type-1 angiotensin II receptor (25 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.57Molecular Weight (Monoisotopic): 438.1283AlogP: 3.93#Rotatable Bonds: 9
Polar Surface Area: 115.56Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.61CX Basic pKa: CX LogP: 4.78CX LogD: 3.84
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.58Np Likeness Score: -0.59

References

1. Wallinder C, Botros M, Rosenström U, Guimond MO, Beaudry H, Nyberg F, Gallo-Payet N, Hallberg A, Alterman M..  (2008)  Selective angiotensin II AT2 receptor agonists: Benzamide structure-activity relationships.,  16  (14): [PMID:18599297] [10.1016/j.bmc.2008.05.066]

Source