The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-[7-ethoxy-4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]-2-fluoro-3-[(2S)-1-methylpyrrolidin-2-yl]prop-2-enamide ID: ALA5181694
PubChem CID: 168272889
Max Phase: Preclinical
Molecular Formula: C30H30FN9O3
Molecular Weight: 583.63
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cc2ncnc(Nc3ccc(Oc4cc5nncn5cn4)c(C)c3)c2cc1NC(=O)/C(F)=C\[C@@H]1CCCN1C
Standard InChI: InChI=1S/C30H30FN9O3/c1-4-42-26-13-23-21(12-24(26)37-30(41)22(31)11-20-6-5-9-39(20)3)29(33-15-32-23)36-19-7-8-25(18(2)10-19)43-28-14-27-38-35-17-40(27)16-34-28/h7-8,10-17,20H,4-6,9H2,1-3H3,(H,37,41)(H,32,33,36)/b22-11+/t20-/m0/s1
Standard InChI Key: BQKAPRHCWWQTIM-OKFCBPFISA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
-1.7152 -0.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0007 -0.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2888 -0.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2888 -1.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9988 -1.8522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7152 -1.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4238 -0.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1387 -0.6168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1406 -1.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4289 -1.8545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4238 0.6208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1385 1.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1387 1.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8516 2.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5664 1.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5680 1.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8562 0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8516 3.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2810 2.2692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9957 1.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7103 2.2692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4249 1.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4249 1.0314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7103 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9957 1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8818 -0.1882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0381 0.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7024 -0.2745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4299 -0.2030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1445 -0.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8592 -0.2030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1445 -1.4408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5738 -0.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4299 -1.8567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4299 -2.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1445 -3.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5738 -1.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9065 -1.9256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1614 -2.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9862 -2.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2410 -1.9256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.0381 -1.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8592 0.6221 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
4 10 1 0
7 11 1 0
11 12 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
14 18 1 0
15 19 1 0
19 20 1 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 1 0
25 24 1 0
20 25 2 0
24 26 2 0
23 27 1 0
27 28 2 0
28 26 1 0
1 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 2 0
6 34 1 0
34 35 1 0
35 36 1 0
37 33 1 6
38 37 1 0
39 38 1 0
40 39 1 0
40 41 1 0
41 37 1 0
41 42 1 0
31 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.63Molecular Weight (Monoisotopic): 583.2456AlogP: 5.20#Rotatable Bonds: 9Polar Surface Area: 131.69Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.90CX Basic pKa: 8.16CX LogP: 3.10CX LogD: 2.26Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.22Np Likeness Score: -1.29
References 1. Li D, Tu Y, Jin K, Duan L, Hong Y, Xu J, Chen N, Zhang Z, Zuo H, Gong W, Zhang J, Wang Q, Qian H, Wang X, Ke Y, Xia G.. (2022) Discovery of SPH5030, a Selective, Potent, and Irreversible Tyrosine Kinase Inhibitor for HER2-Amplified and HER2-Mutant Cancer Treatment., 65 (7.0): [PMID:35319895 ] [10.1021/acs.jmedchem.1c00710 ]