ID: ALA5181806

PubChem CID: 168277911

Max Phase: Preclinical

Molecular Formula: C20H14N2O7

Molecular Weight: 394.34

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1OCC2=C1C(c1cc3c(cc1[N+](=O)[O-])COC3)c1cc3c(cc1N2)OCO3

Standard InChI:  InChI=1S/C20H14N2O7/c23-20-19-14(7-27-20)21-13-4-17-16(28-8-29-17)3-11(13)18(19)12-1-9-5-26-6-10(9)2-15(12)22(24)25/h1-4,18,21H,5-8H2

Standard InChI Key:  ZSVBOWDUTFYTKH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 34  0  0  0  0  0  0  0  0999 V2000
   -1.4253    2.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7107    2.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0011    2.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0011    1.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7089    0.8592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4253    1.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7157    2.5087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4304    2.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4304    1.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7157    0.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2151    1.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2152    2.3510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7001    1.6834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4287    0.2188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2131    2.3517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2132    1.0112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7001    1.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7157    0.0331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4303   -0.3796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4295   -1.2023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147   -1.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0028   -1.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0018   -0.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7165    0.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4312   -0.3811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1291    0.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8863   -2.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0429   -1.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7071   -2.5087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  4 10  1  0
  9 11  1  0
  8 12  1  0
 12 13  1  0
 13 11  1  0
 11 14  2  0
  1 15  1  0
  6 16  1  0
 16 17  1  0
 17 15  1  0
 10 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 21 27  1  0
 20 28  1  0
 28 29  1  0
 29 27  1  0
M  CHG  2  24   1  25  -1
M  END

Alternative Forms

  1. Parent:

    ALA5181806

    ---

Associated Targets(non-human)

Porphyromonas gingivalis (651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.34Molecular Weight (Monoisotopic): 394.0801AlogP: 2.72#Rotatable Bonds: 2
Polar Surface Area: 109.16Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.81CX Basic pKa: CX LogP: 1.91CX LogD: 1.91
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: -0.29

References

1. Silva JG, de Miranda AS, Ismail FMD, Barbosa LCA..  (2022)  Synthesis and medicinal chemistry of tetronamides: Promising agrochemicals and antitumoral compounds.,  67  [PMID:35598527] [10.1016/j.bmc.2022.116815]

Source