The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5181806
PubChem CID: 168277911
Max Phase: Preclinical
Molecular Formula: C20H14N2O7
Molecular Weight: 394.34
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1OCC2=C1C(c1cc3c(cc1[N+](=O)[O-])COC3)c1cc3c(cc1N2)OCO3
Standard InChI: InChI=1S/C20H14N2O7/c23-20-19-14(7-27-20)21-13-4-17-16(28-8-29-17)3-11(13)18(19)12-1-9-5-26-6-10(9)2-15(12)22(24)25/h1-4,18,21H,5-8H2
Standard InChI Key: ZSVBOWDUTFYTKH-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 34 0 0 0 0 0 0 0 0999 V2000
-1.4253 2.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7107 2.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0011 2.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0011 1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7089 0.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4253 1.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7157 2.5087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4304 2.0960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4304 1.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7157 0.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2151 1.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2152 2.3510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7001 1.6834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4287 0.2188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2131 2.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2132 1.0112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7001 1.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7157 0.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4303 -0.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4295 -1.2023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 -1.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0028 -1.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0018 -0.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7165 0.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4312 -0.3811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1291 0.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8863 -2.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0429 -1.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7071 -2.5087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 2 0
10 9 1 0
4 10 1 0
9 11 1 0
8 12 1 0
12 13 1 0
13 11 1 0
11 14 2 0
1 15 1 0
6 16 1 0
16 17 1 0
17 15 1 0
10 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
18 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
21 27 1 0
20 28 1 0
28 29 1 0
29 27 1 0
M CHG 2 24 1 25 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.34Molecular Weight (Monoisotopic): 394.0801AlogP: 2.72#Rotatable Bonds: 2Polar Surface Area: 109.16Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.81CX Basic pKa: ┄CX LogP: 1.91CX LogD: 1.91Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: -0.29
References 1. Silva JG, de Miranda AS, Ismail FMD, Barbosa LCA.. (2022) Synthesis and medicinal chemistry of tetronamides: Promising agrochemicals and antitumoral compounds., 67 [PMID:35598527 ] [10.1016/j.bmc.2022.116815 ]