The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,3'-Dipropanoyloxy-3,6,7,4'-tetramethoxyflavone ID: ALA518205
PubChem CID: 10961939
Max Phase: Preclinical
Molecular Formula: C25H26O10
Molecular Weight: 486.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Oc1cc(-c2oc3cc(OC)c(OC)c(OC(=O)CC)c3c(=O)c2OC)ccc1OC
Standard InChI: InChI=1S/C25H26O10/c1-7-18(26)33-15-11-13(9-10-14(15)29-3)22-25(32-6)21(28)20-16(34-22)12-17(30-4)23(31-5)24(20)35-19(27)8-2/h9-12H,7-8H2,1-6H3
Standard InChI Key: XSZOOYSZBJIXTE-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
-3.6453 -15.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6466 -16.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9336 -16.6266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9356 -14.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2175 -15.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2137 -16.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4939 -16.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7732 -16.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7769 -15.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5014 -14.9598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0654 -14.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6508 -15.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3633 -14.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3609 -14.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6400 -13.7236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0696 -14.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3602 -14.9742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3616 -16.6252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9362 -17.4516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4914 -17.4521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0575 -16.6197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0734 -13.7176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0790 -15.3698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0695 -12.8926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3608 -14.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0755 -16.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0550 -17.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6520 -17.8618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7922 -14.9551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3651 -17.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6546 -18.6868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5079 -15.3655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7898 -14.1301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2211 -14.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0809 -17.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
1 17 1 0
5 10 1 0
2 18 1 0
6 7 1 0
3 19 1 0
7 8 1 0
7 20 2 0
8 9 2 0
8 21 1 0
9 10 1 0
14 22 1 0
5 6 1 0
13 23 1 0
22 24 1 0
11 12 2 0
17 25 1 0
2 3 1 0
18 26 1 0
12 13 1 0
21 27 1 0
3 6 2 0
19 28 1 0
13 14 2 0
23 29 1 0
1 2 2 0
28 30 1 0
14 15 1 0
28 31 2 0
5 4 2 0
29 32 1 0
15 16 2 0
29 33 2 0
16 11 1 0
32 34 1 0
9 11 1 0
30 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.47Molecular Weight (Monoisotopic): 486.1526AlogP: 4.13#Rotatable Bonds: 9Polar Surface Area: 119.73Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.98CX LogD: 2.98Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: 0.72
References 1. Díaz F, Chávez D, Lee D, Mi Q, Chai HB, Tan GT, Kardono LB, Riswan S, Fairchild CR, Wild R, Farnsworth NR, Cordell GA, Pezzuto JM, Kinghorn AD.. (2003) Cytotoxic flavone analogues of vitexicarpin, a constituent of the leaves of Vitex negundo., 66 (6): [PMID:12828478 ] [10.1021/np0300784 ]