(2-(3-(dibenzo[b,d]furan-1-yl)phenyl)-1-hydroxyethane-1,1-diyl)bis(phosphonic acid)

ID: ALA5182237

PubChem CID: 168273917

Max Phase: Preclinical

Molecular Formula: C20H18O8P2

Molecular Weight: 448.30

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=P(O)(O)C(O)(Cc1cccc(-c2cccc3oc4ccccc4c23)c1)P(=O)(O)O

Standard InChI:  InChI=1S/C20H18O8P2/c21-20(29(22,23)24,30(25,26)27)12-13-5-3-6-14(11-13)15-8-4-10-18-19(15)16-7-1-2-9-17(16)28-18/h1-11,21H,12H2,(H2,22,23,24)(H2,25,26,27)

Standard InChI Key:  RPSNFUUAMLPYFI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -0.7735    1.1353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7735    0.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0601   -0.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6468    0.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6468    1.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0620    1.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3584    1.5466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0701    1.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0701    0.3140    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    2.7816   -0.0967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2748    0.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8574   -0.4796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8933    1.1357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4817    1.8468    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    2.0717    2.5589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1946    1.4352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1946    2.2569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0601   -0.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7748   -1.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7748   -2.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0612   -2.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6505   -2.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6505   -1.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5690   -2.4051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0413   -1.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5554   -1.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8919   -0.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7127   -0.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1946   -0.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8594   -1.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
  9 12  1  0
  8 13  1  0
  8 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  2  0
 18  3  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 18  2  0
 20 24  1  0
 24 25  1  0
 26 25  2  0
 19 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5182237

    ---

Associated Targets(non-human)

ispU Ditrans,polycis-undecaprenyl-diphosphate synthase ((2E,6E)-farnesyl-diphosphate specific) (10 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.30Molecular Weight (Monoisotopic): 448.0477AlogP: 3.80#Rotatable Bonds: 5
Polar Surface Area: 148.43Molecular Species: ACIDHBA: 4HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 0.69CX Basic pKa: CX LogP: 2.47CX LogD: -2.47
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.29Np Likeness Score: 0.34

References

1. Barbosa JS, Almeida Paz FA, Braga SS..  (2021)  Bisphosphonates, Old Friends of Bones and New Trends in Clinics.,  64  (3.0): [PMID:33522236] [10.1021/acs.jmedchem.0c01292]

Source