The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2-(3-(dibenzo[b,d]furan-1-yl)phenyl)-1-hydroxyethane-1,1-diyl)bis(phosphonic acid) ID: ALA5182237
PubChem CID: 168273917
Max Phase: Preclinical
Molecular Formula: C20H18O8P2
Molecular Weight: 448.30
Associated Items:
Names and Identifiers Canonical SMILES: O=P(O)(O)C(O)(Cc1cccc(-c2cccc3oc4ccccc4c23)c1)P(=O)(O)O
Standard InChI: InChI=1S/C20H18O8P2/c21-20(29(22,23)24,30(25,26)27)12-13-5-3-6-14(11-13)15-8-4-10-18-19(15)16-7-1-2-9-17(16)28-18/h1-11,21H,12H2,(H2,22,23,24)(H2,25,26,27)
Standard InChI Key: RPSNFUUAMLPYFI-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-0.7735 1.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7735 0.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0601 -0.0960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6468 0.3140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6468 1.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0620 1.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3584 1.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0701 1.1357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0701 0.3140 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
2.7816 -0.0967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2748 0.1009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8574 -0.4796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8933 1.1357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4817 1.8468 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
2.0717 2.5589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1946 1.4352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1946 2.2569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0601 -0.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7748 -1.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7748 -2.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0612 -2.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6505 -2.1480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6505 -1.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5690 -2.4051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0413 -1.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5554 -1.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8919 -0.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7127 -0.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1946 -0.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8594 -1.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
9 11 1 0
9 12 1 0
8 13 1 0
8 14 1 0
14 15 1 0
14 16 1 0
14 17 2 0
18 3 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 18 2 0
20 24 1 0
24 25 1 0
26 25 2 0
19 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
25 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.30Molecular Weight (Monoisotopic): 448.0477AlogP: 3.80#Rotatable Bonds: 5Polar Surface Area: 148.43Molecular Species: ACIDHBA: 4HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 0.69CX Basic pKa: ┄CX LogP: 2.47CX LogD: -2.47Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.29Np Likeness Score: 0.34