The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(4-chloro-6-fluoropyridin-3-yloxy)pyridin-2-yl)-2-((S)-4,4-difluoro-3-(6-oxo-1,6-dihydropyridin-3-yl)piperidin-1-yl)propanamide ID: ALA5182351
PubChem CID: 168274364
Max Phase: Preclinical
Molecular Formula: C23H21ClF3N5O3
Molecular Weight: 507.90
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C(=O)Nc1ccc(Oc2cnc(F)cc2Cl)cn1)N1CCC(F)(F)[C@@H](c2ccc(=O)[nH]c2)C1
Standard InChI: InChI=1S/C23H21ClF3N5O3/c1-13(32-7-6-23(26,27)16(12-32)14-2-5-21(33)30-9-14)22(34)31-20-4-3-15(10-29-20)35-18-11-28-19(25)8-17(18)24/h2-5,8-11,13,16H,6-7,12H2,1H3,(H,30,33)(H,29,31,34)/t13?,16-/m1/s1
Standard InChI Key: QTLDRMTVXMRUSU-FQNRMIAFSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
3.1754 -1.0087 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4633 -1.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1800 -1.8336 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.6346 4.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4574 4.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8715 3.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4641 2.8678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6381 2.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2276 3.5759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8788 2.1552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4690 1.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8889 0.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4797 0.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6542 0.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2396 0.7284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6511 1.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2188 4.9980 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6961 3.5868 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.2435 -0.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4189 -0.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0082 -1.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8164 -1.4228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4220 -2.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0051 0.0071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2271 -2.1377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2301 -0.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0548 -0.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0517 -2.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4625 -2.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0469 -3.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4569 -4.2814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2824 -4.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6961 -3.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2836 -2.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6941 -4.9980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
4 17 1 0
6 18 1 0
14 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
20 24 2 0
22 25 1 0
22 26 1 0
26 27 1 0
27 2 1 0
25 28 1 0
28 2 1 0
28 29 1 1
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.90Molecular Weight (Monoisotopic): 507.1285AlogP: 4.20#Rotatable Bonds: 6Polar Surface Area: 100.21Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.00CX Basic pKa: 6.62CX LogP: 2.82CX LogD: 2.76Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.49Np Likeness Score: -1.12