N-cyclohexyl-2-nitro-4-((trichloromethyl)sulfonyl)aniline

ID: ALA5182658

PubChem CID: 168281240

Max Phase: Preclinical

Molecular Formula: C13H15Cl3N2O4S

Molecular Weight: 401.70

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=[N+]([O-])c1cc(S(=O)(=O)C(Cl)(Cl)Cl)ccc1NC1CCCCC1

Standard InChI:  InChI=1S/C13H15Cl3N2O4S/c14-13(15,16)23(21,22)10-6-7-11(12(8-10)18(19)20)17-9-4-2-1-3-5-9/h6-9,17H,1-5H2

Standard InChI Key:  DDUQPWNKIYQWFC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   -3.2129    0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4984    0.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7840    0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7840   -0.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4984   -1.0858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2129   -0.6733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0699    0.5639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3556    0.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3585    0.5637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0703    0.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0703   -0.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3604   -1.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3556   -0.6766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845   -1.0852    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4987   -0.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4987    0.1517    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.2129   -1.0852    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.2129   -0.2605    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.3714   -1.8008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1961   -1.8008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3585    1.3884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0728    1.8008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3555    1.8008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  1  6  1  0
  3  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
 14 19  2  0
 14 20  2  0
 21  9  1  0
 21 22  1  0
 21 23  2  0
M  CHG  2  21   1  22  -1
M  END

Alternative Forms

  1. Parent:

    ALA5182658

    ---

Associated Targets(Human)

WNK1 Tchem Serine/threonine-protein kinase WNK1 (297 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.70Molecular Weight (Monoisotopic): 399.9818AlogP: 4.44#Rotatable Bonds: 4
Polar Surface Area: 89.31Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.28CX Basic pKa: CX LogP: 5.40CX LogD: 5.40
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.46Np Likeness Score: -1.39

References

1. Rodriguez M, Kannangara A, Chlebowicz J, Akella R, He H, Tambar UK, Goldsmith EJ..  (2022)  Synthesis and Structural Characterization of Novel Trihalo-sulfone Inhibitors of WNK1.,  13  (10.0): [PMID:36262391] [10.1021/acsmedchemlett.2c00216]

Source