Diethyl ((E)-3-(3-bromophenyl)acryloyl)glycyl-L-valyl-D-glutamate

ID: ALA5182728

PubChem CID: 168278441

Max Phase: Preclinical

Molecular Formula: C25H34BrN3O7

Molecular Weight: 568.47

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1cccc(Br)c1)C(C)C)C(=O)OCC

Standard InChI:  InChI=1S/C25H34BrN3O7/c1-5-35-22(32)13-11-19(25(34)36-6-2)28-24(33)23(16(3)4)29-21(31)15-27-20(30)12-10-17-8-7-9-18(26)14-17/h7-10,12,14,16,19,23H,5-6,11,13,15H2,1-4H3,(H,27,30)(H,28,33)(H,29,31)/b12-10+/t19-,23+/m1/s1

Standard InChI Key:  CSMOGDAZBSQCHI-XSIWJGCBSA-N

Molfile:  

 
     RDKit          2D

 36 36  0  0  0  0  0  0  0  0999 V2000
   -2.8792    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1648    0.8613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8792   -0.3764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5939    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3087    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0234    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7382    0.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4504    0.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4504    1.6865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7400    2.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0234    1.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4500    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7353    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0207    0.4487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7353    1.6866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6940    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4087    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6940    1.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1233    0.8613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4087   -0.3765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8381    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5528    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2674    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9822    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6969    0.4487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4115    0.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8381   -0.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5528   -0.7891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1233   -0.7891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5528   -1.6144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8854   -2.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1651    0.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9822    1.6866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4087    2.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0207    2.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1651    0.4484    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  2  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 16 18  1  1
 17 19  1  0
 17 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 27  1  6
 27 28  1  0
 27 29  2  0
 28 30  1  0
 31 30  1  0
 32 26  1  0
 24 33  2  0
 34 18  1  0
 18 35  1  0
  8 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5182728

    ---

Associated Targets(Human)

NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.47Molecular Weight (Monoisotopic): 567.1580AlogP: 2.11#Rotatable Bonds: 14
Polar Surface Area: 139.90Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.82CX Basic pKa: CX LogP: 2.27CX LogD: 2.27
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -0.47

References

1. Guzelj S, Bizjak Š, Jakopin Ž..  (2022)  Discovery of Desmuramylpeptide NOD2 Agonists with Single-Digit Nanomolar Potency.,  13  (8.0): [PMID:35978688] [10.1021/acsmedchemlett.2c00121]

Source