(S)-6-(4-(diethylcarbamoyl)phenyl)-N-(3-(2-fluorophenyl)-1-(methylamino)-1-oxopropan-2-yl)-3H-imidazo[4,5-b]pyridine-5-carboxamide

ID: ALA5182857

PubChem CID: 168284094

Max Phase: Preclinical

Molecular Formula: C28H29FN6O3

Molecular Weight: 516.58

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)C(=O)c1ccc(-c2cc3nc[nH]c3nc2C(=O)N[C@@H](Cc2ccccc2F)C(=O)NC)cc1

Standard InChI:  InChI=1S/C28H29FN6O3/c1-4-35(5-2)28(38)18-12-10-17(11-13-18)20-15-22-25(32-16-31-22)34-24(20)27(37)33-23(26(36)30-3)14-19-8-6-7-9-21(19)29/h6-13,15-16,23H,4-5,14H2,1-3H3,(H,30,36)(H,33,37)(H,31,32,34)/t23-/m0/s1

Standard InChI Key:  UCHKYNGLDMNIHU-QHCPKHFHSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   -3.1358    0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4213    0.6179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7066    0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9919    0.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9919    1.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7066    1.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4215    1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1337    1.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1337    2.6809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4233    3.0929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7066    2.6846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9919    3.0973    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2772    0.2053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4374    0.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1521    0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8670    0.6177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5791    0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5791   -0.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8687   -1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1521   -0.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4374   -1.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2803   -0.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9906   -1.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9906   -1.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2757   -2.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4374   -1.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7053   -2.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7053   -3.0973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4200   -1.8593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1347   -2.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8494   -1.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4200   -1.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1347   -0.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3642   -0.8748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8494   -0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3642    0.4608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4374    1.4432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7066   -0.6199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  6
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
 11 12  1  0
  4 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 21 20  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 21  2  0
 24 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 29 32  1  0
 32 33  1  0
 18 34  1  0
 35 34  2  0
 36 35  1  0
 17 36  1  0
 14 37  2  0
  3 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5182857

    ---

Associated Targets(non-human)

ddlB D-alanylalanine synthetase (66 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.58Molecular Weight (Monoisotopic): 516.2285AlogP: 3.33#Rotatable Bonds: 9
Polar Surface Area: 120.08Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.72CX Basic pKa: 2.35CX LogP: 2.79CX LogD: 2.79
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.32Np Likeness Score: -1.19

References

1. Proj M, Bozovičar K, Hrast M, Frlan R, Gobec S..  (2022)  DNA-encoded library screening on two validated enzymes of the peptidoglycan biosynthetic pathway.,  73  [PMID:35917835] [10.1016/j.bmcl.2022.128915]

Source