3-(4-chlorophenyl)-4-oxo-N-[(pyridin-3-yl)methyl]-3,4-dihydrophthalazine-1-carboxamide

ID: ALA5182874

PubChem CID: 168284105

Max Phase: Preclinical

Molecular Formula: C21H15ClN4O2

Molecular Weight: 390.83

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCc1cccnc1)c1nn(-c2ccc(Cl)cc2)c(=O)c2ccccc12

Standard InChI:  InChI=1S/C21H15ClN4O2/c22-15-7-9-16(10-8-15)26-21(28)18-6-2-1-5-17(18)19(25-26)20(27)24-13-14-4-3-11-23-12-14/h1-12H,13H2,(H,24,27)

Standard InChI Key:  GNYISOPTUVLGOO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -2.8557   -0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1411   -0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4293   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4293   -1.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1394   -2.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8557   -1.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -0.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002   -0.8242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002   -1.6493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -2.8870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7143   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4291   -1.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1412   -2.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1412   -2.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4309   -3.2988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7143   -2.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8557   -3.2994    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147    0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4293    0.8259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002    0.8259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002    1.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7143    2.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7146    2.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4274    3.2994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1422    2.8868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1438    2.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4320    1.6493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
 10 11  2  0
  9 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 12 17  1  0
 15 18  1  0
  7 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5182874

    ---

Associated Targets(Human)

A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
K562 (73714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
K562/A02 (383 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ABCB1 Tchem P-glycoprotein 1 (14716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

MDCK (10148 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.83Molecular Weight (Monoisotopic): 390.0884AlogP: 3.36#Rotatable Bonds: 4
Polar Surface Area: 76.88Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.48CX Basic pKa: 4.82CX LogP: 3.20CX LogD: 3.20
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.58Np Likeness Score: -2.00

References

1. Shi W, Zhang P, Zou F, Zhou J, Yin Z, Cai Z, Ghaleb H, Jiang Y, Huang W, Liu Y, Qiu Q, Qian H..  (2022)  Exploration of novel phthalazinone derivatives as potential efflux transporter inhibitors for reversing multidrug resistance and improving the oral absorption of paclitaxel.,  233  [PMID:35247755] [10.1016/j.ejmech.2022.114231]

Source