(Z)-1-[[5-[2-(4-methoxyphenyl)-4-quinolyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-3-methylene-hex-4-en-2-one oxime

ID: ALA5183049

PubChem CID: 168278463

Max Phase: Preclinical

Molecular Formula: C31H27N5O2S

Molecular Weight: 533.66

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(/C=C\C)/C(CSc1nnc(-c2cc(-c3ccc(OC)cc3)nc3ccccc23)n1-c1ccccc1)=N\O

Standard InChI:  InChI=1S/C31H27N5O2S/c1-4-10-21(2)29(35-37)20-39-31-34-33-30(36(31)23-11-6-5-7-12-23)26-19-28(22-15-17-24(38-3)18-16-22)32-27-14-9-8-13-25(26)27/h4-19,37H,2,20H2,1,3H3/b10-4-,35-29-

Standard InChI Key:  NAGGUQTYDIRZGO-OZPDOQDOSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   -3.7232   -1.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0086   -1.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2967   -1.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2967   -2.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0069   -3.0581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7232   -2.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0073   -0.5892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2946   -0.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5854   -0.5866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5811   -1.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2946    0.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0070    1.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0062    1.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2936    2.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5838    1.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5791    1.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2936    3.1101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0060    3.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8687   -1.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1176   -1.4854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4326   -2.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0215   -2.8086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7827   -2.6376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0953   -0.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4862   -0.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2732    0.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5216    0.8960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1015    0.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8933   -0.4770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2553   -2.0965    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6666   -1.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4893   -1.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9005   -0.6716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9005   -2.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7232   -0.6716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7232   -2.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4893   -2.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9005   -3.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7232   -3.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  2  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  3 10  1  0
 11  8  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 11 16  1  0
 16 15  2  0
 14 17  1  0
 17 18  1  0
 10 19  1  0
 20 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  2  0
 20 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 24 29  1  0
 21 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 33 35  1  0
 34 36  2  0
 34 37  1  0
 37 38  2  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5183049

    ---

Associated Targets(Human)

MT-CO2 Tchem Cytochrome c oxidase subunit 2 (250 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.66Molecular Weight (Monoisotopic): 533.1885AlogP: 7.21#Rotatable Bonds: 9
Polar Surface Area: 85.42Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.90CX Basic pKa: 2.86CX LogP: 7.33CX LogD: 7.33
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.07Np Likeness Score: -1.08

References

1. Neha K, Wakode S..  (2021)  Contemporary advances of cyclic molecules proposed for inflammation.,  221  [PMID:34029774] [10.1016/j.ejmech.2021.113493]

Source