(R)-2-(4-bromo-1,5-dimethyl-1H-pyrazole-3-carboxamido)-3-(4-(3-(3-p-tolylureido)prop-1-ynyl)phenyl)propanoic acid

ID: ALA5183101

PubChem CID: 168281244

Max Phase: Preclinical

Molecular Formula: C26H26BrN5O4

Molecular Weight: 552.43

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)NCC#Cc2ccc(C[C@@H](NC(=O)c3nn(C)c(C)c3Br)C(=O)O)cc2)cc1

Standard InChI:  InChI=1S/C26H26BrN5O4/c1-16-6-12-20(13-7-16)29-26(36)28-14-4-5-18-8-10-19(11-9-18)15-21(25(34)35)30-24(33)23-22(27)17(2)32(3)31-23/h6-13,21H,14-15H2,1-3H3,(H,30,33)(H,34,35)(H2,28,29,36)/t21-/m1/s1

Standard InChI Key:  XFEBOKPGUIDSHM-OAQYLSRUSA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   13.9541   -3.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2108   -2.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5416   -2.1875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8765   -2.6742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5402   -1.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4381   -4.1262    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   14.9958   -2.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1291   -3.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6433   -4.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8229   -4.0378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9778   -4.8792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4920   -5.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8265   -6.3002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6717   -5.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3371   -4.7047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1859   -6.1255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3408   -6.9669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5199   -6.8775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0343   -7.5435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3688   -8.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1937   -8.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6757   -7.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8839   -8.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4000   -9.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9184  -10.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2576  -11.0607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0785  -11.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4178  -11.8950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2386  -11.9773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5737  -12.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3938  -12.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8763  -12.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5329  -11.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7138  -11.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6973  -12.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5602  -10.4732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  8  2  0
  3  5  1  0
  1  6  1  0
  2  7  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  6
 12 14  1  0
 14 15  2  0
 14 16  1  0
 13 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 23 24  3  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 27 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5183101

    ---

Associated Targets(Human)

ALPP Tbio Alkaline phosphatase placental type (103 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 552.43Molecular Weight (Monoisotopic): 551.1168AlogP: 3.40#Rotatable Bonds: 7
Polar Surface Area: 125.35Molecular Species: ACIDHBA: 5HBD: 4
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.74CX Basic pKa: 0.10CX LogP: 4.37CX LogD: 0.87
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.36

References

1. Bassi G, Favalli N, Pellegrino C, Onda Y, Scheuermann J, Cazzamalli S, Manz MG, Neri D..  (2021)  Specific Inhibitor of Placental Alkaline Phosphatase Isolated from a DNA-Encoded Chemical Library Targets Tumor of the Female Reproductive Tract.,  64  (21.0): [PMID:34709820] [10.1021/acs.jmedchem.1c01103]

Source