5-(3-Allyloxyphenyl)-2-amino-5,8-dihydropyrido[2,3-d]pyrimidine-4,7(3H,6H)-dione

ID: ALA5183266

PubChem CID: 142550460

Max Phase: Preclinical

Molecular Formula: C16H16N4O3

Molecular Weight: 312.33

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CCOc1cccc(C2CC(=O)Nc3nc(N)[nH]c(=O)c32)c1

Standard InChI:  InChI=1S/C16H16N4O3/c1-2-6-23-10-5-3-4-9(7-10)11-8-12(21)18-14-13(11)15(22)20-16(17)19-14/h2-5,7,11H,1,6,8H2,(H4,17,18,19,20,21,22)

Standard InChI Key:  RBDDQWALLRHOQW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    0.0000   -1.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -1.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289   -2.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -3.0919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -0.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0003   -0.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0010    0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7155    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4270    0.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4317   -0.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7144   -3.0919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -2.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289   -1.8543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7144   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7144   -0.6171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1432   -3.0918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1432   -3.0918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7132    1.0300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7132    1.8548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274    2.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274    3.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  2  0
  6  5  1  0
  7  2  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
  7 12  1  0
 12 11  2  0
  6 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
  1 16  1  0
 16 17  2  0
  4 18  2  0
 14 19  1  0
  9 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5183266

    ---

Associated Targets(Human)

ADCYAP1R1 Tchem Pituitary adenylate cyclase-activating polypeptide type I receptor (345 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 312.33Molecular Weight (Monoisotopic): 312.1222AlogP: 1.39#Rotatable Bonds: 4
Polar Surface Area: 110.10Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 7.98CX Basic pKa: 2.08CX LogP: 0.71CX LogD: 0.63
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.74Np Likeness Score: -0.45

References

1. Takasaki I, Watanabe A, Okada T, Kanayama D, Nagashima R, Shudo M, Shimodaira A, Nunomura K, Lin B, Watanabe Y, Gouda H, Miyata A, Kurihara T, Toyooka N..  (2022)  Design and synthesis of pyrido[2,3-d]pyrimidine derivatives for a novel PAC1 receptor antagonist.,  231  [PMID:35124531] [10.1016/j.ejmech.2022.114160]

Source