The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-Butyl (4-(5-carbamoyl-2-(1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamido)-1H-benzo[d]imidazol-1-yl)butyl)carbamate ID: ALA5183483
PubChem CID: 165146895
Max Phase: Preclinical
Molecular Formula: C23H28F3N7O4
Molecular Weight: 523.52
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(C(=O)Nc2nc3cc(C(N)=O)ccc3n2CCCCNC(=O)OC(C)(C)C)c(C(F)(F)F)n1
Standard InChI: InChI=1S/C23H28F3N7O4/c1-22(2,3)37-21(36)28-9-5-6-10-33-16-8-7-13(18(27)34)11-15(16)29-20(33)30-19(35)14-12-32(4)31-17(14)23(24,25)26/h7-8,11-12H,5-6,9-10H2,1-4H3,(H2,27,34)(H,28,36)(H,29,30,35)
Standard InChI Key: JADDLSAZXVQDRH-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
-2.5585 -1.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5597 -1.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8470 -2.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1351 -1.9317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1354 -1.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8487 -0.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3518 -0.8527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1328 -1.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3514 -2.1861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9554 -1.5189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3664 -0.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1890 -0.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6699 -1.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4522 -1.2166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4519 -0.3939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6695 -0.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1645 0.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4570 -2.2658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0388 -2.8477 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.6622 -2.4788 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2440 -3.0606 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9548 -0.0941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0979 -0.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2724 -2.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2731 -3.1695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9845 -1.9351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6486 0.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3946 1.3235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9454 1.9348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7502 1.7634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3009 2.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1057 2.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0880 3.1695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3597 1.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1645 1.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7779 0.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5933 0.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
5 4 1 0
5 6 2 0
6 1 1 0
7 5 1 0
8 7 1 0
9 8 2 0
4 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
15 17 1 0
13 18 1 0
18 19 1 0
18 20 1 0
18 21 1 0
11 22 2 0
7 23 1 0
2 24 1 0
24 25 2 0
24 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.52Molecular Weight (Monoisotopic): 523.2155AlogP: 3.44#Rotatable Bonds: 8Polar Surface Area: 146.16Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.38CX Basic pKa: 1.34CX LogP: 3.07CX LogD: 3.07Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -1.80
References 1. Jeon MJ, Lee H, Lee J, Baek SY, Lee D, Jo S, Lee JY, Kang M, Jung HR, Han SB, Kim NJ, Lee S, Kim H.. (2022) Development of Potent Immune Modulators Targeting Stimulator of Interferon Genes Receptor., 65 (7.0): [PMID:35315650 ] [10.1021/acs.jmedchem.1c01795 ]