4-bromo-3-[15-(2-bromo-5-hydroxy-phenyl)-21,23-dihydroporphyrin-5-yl]phenol

ID: ALA5183485

PubChem CID: 135499927

Max Phase: Preclinical

Molecular Formula: C32H20Br2N4O2

Molecular Weight: 652.35

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1ccc(Br)c(-c2c3nc(cc4ccc([nH]4)c(-c4cc(O)ccc4Br)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1

Standard InChI:  InChI=1S/C32H20Br2N4O2/c33-25-7-5-21(39)15-23(25)31-27-9-1-17(35-27)13-18-2-10-29(36-18)32(24-16-22(40)6-8-26(24)34)30-12-4-20(38-30)14-19-3-11-28(31)37-19/h1-16,35,38-40H/b17-13-,18-13-,19-14-,20-14-,31-27-,31-28-,32-29-,32-30-

Standard InChI Key:  PBQVOHAZHMMQFZ-ALKMYCTKSA-N

Molfile:  

 
     RDKit          2D

 40 46  0  0  0  0  0  0  0  0999 V2000
   -4.6792   -0.1898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0825    0.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2958    0.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7261    0.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9432    1.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7298    1.7361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2995    1.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3660    2.0962    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -1.9395    0.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7768   -0.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0443   -0.5967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1257   -1.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5018   -1.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2848   -1.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6103   -1.0308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4240   -1.1122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9666   -0.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7532   -0.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9703   -1.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7569   -1.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3266   -1.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1096   -0.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6792    0.2169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3229   -0.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3931   -2.0962    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    1.8038    0.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0443    0.6238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1528    1.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5289    1.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2576    1.7903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8544    2.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5597    1.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3970    1.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5832    1.0579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9395    1.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3464    0.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5868   -1.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8815   -2.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9124   -1.5733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3193   -0.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  7  6  1  0
  2  7  2  0
  5  8  1  0
  4  9  1  0
 10  9  2  0
 10 11  1  0
 12 11  2  0
 12 13  1  0
 14 13  2  0
 14 15  1  0
 15 16  1  0
 17 16  2  0
 17 18  1  0
 18 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 22 23  1  0
 24 22  1  0
 18 24  2  0
 19 25  1  0
 26 17  1  0
 26 27  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 30 31  2  0
 31 32  1  0
 33 32  2  0
  9 33  1  0
 33 34  1  0
 34 30  1  0
 28 35  1  0
 35 36  2  0
 36 26  1  0
 16 37  1  0
 37 38  2  0
 38 14  1  0
 39 12  1  0
 40 39  2  0
 40 10  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5183485

    ---

Associated Targets(Human)

WiDr (1835 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 652.35Molecular Weight (Monoisotopic): 649.9953AlogP: 8.93#Rotatable Bonds: 2
Polar Surface Area: 97.82Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.51CX Basic pKa: 5.08CX LogP: 8.86CX LogD: 8.82
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.15Np Likeness Score: 0.27

References

1. Janas K, Boniewska-Bernacka E, Dyrda G, Słota R..  (2021)  Porphyrin and phthalocyanine photosensitizers designed for targeted photodynamic therapy of colorectal cancer.,  30  [PMID:33341498] [10.1016/j.bmc.2020.115926]

Source