2-(3,4-dimethoxyphenyl)-5-(4-(dipropylamino)butoxy)-3,7-dimethoxy-4H-chromen-4-one

ID: ALA5183604

PubChem CID: 168278811

Max Phase: Preclinical

Molecular Formula: C29H39NO7

Molecular Weight: 513.63

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCN(CCC)CCCCOc1cc(OC)cc2oc(-c3ccc(OC)c(OC)c3)c(OC)c(=O)c12

Standard InChI:  InChI=1S/C29H39NO7/c1-7-13-30(14-8-2)15-9-10-16-36-24-18-21(32-3)19-25-26(24)27(31)29(35-6)28(37-25)20-11-12-22(33-4)23(17-20)34-5/h11-12,17-19H,7-10,13-16H2,1-6H3

Standard InChI Key:  LOVLGZAUOUGDBQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   -4.2849   -2.2674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5704   -1.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8559   -2.2674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8559   -3.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5704   -3.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5704   -4.3301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1413   -1.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1413   -1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4269   -0.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4269    0.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7123    0.6201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7123    1.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286    1.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4286    2.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1431    3.0940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8576    2.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7141    3.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0023    2.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    3.0943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4266    2.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1410    3.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8586    2.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5704    3.0964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2849    2.6840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9993    3.0964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5704    3.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2833    4.3300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9978    3.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8541    4.3301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1410    3.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4266    1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1410    1.4443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8557    1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7120    0.6193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0023    1.8569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9993   -1.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  3  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 14 15  1  0
 15 16  1  0
 17 14  2  0
 18 17  1  0
 18 19  1  0
 20 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  2  0
 29 30  1  0
 30 21  2  0
 31 20  2  0
 31 32  1  0
 32 33  1  0
 34 31  1  0
 34 35  2  0
 36 34  1  0
 12 36  1  0
 36 18  2  0
  1 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5183604

    ---

Associated Targets(Human)

dsDNA (365 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.63Molecular Weight (Monoisotopic): 513.2727AlogP: 5.78#Rotatable Bonds: 15
Polar Surface Area: 79.60Molecular Species: BASEHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.10CX LogP: 4.56CX LogD: 1.92
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: 0.14

References

1. Rangel VM, Gu L, Chen G, Chen QH, Xue L..  (2022)  5-Substituted 3, 3', 4', 7-tetramethoxyflavonoids - A novel class of potent DNA triplex specific binding ligands.,  61  [PMID:35143982] [10.1016/j.bmcl.2022.128608]

Source