The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Hydroxy-1-(4-methoxybenzyl)-N-(1-phenyl-1H-benzo[d]imidazole-5-yl)-1H-1,2,3-triazole-5-carboxamide ID: ALA5183881
PubChem CID: 168284153
Max Phase: Preclinical
Molecular Formula: C24H20N6O3
Molecular Weight: 440.46
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cn2nnc(O)c2C(=O)Nc2ccc3c(c2)ncn3-c2ccccc2)cc1
Standard InChI: InChI=1S/C24H20N6O3/c1-33-19-10-7-16(8-11-19)14-30-22(24(32)27-28-30)23(31)26-17-9-12-21-20(13-17)25-15-29(21)18-5-3-2-4-6-18/h2-13,15,32H,14H2,1H3,(H,26,31)
Standard InChI Key: OKQBCSHKMAYKNR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-5.0510 -2.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0510 -1.8412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3365 -1.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6204 -1.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9104 -1.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9104 -0.6001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6222 -0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3365 -0.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1961 -0.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1961 0.6371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9104 1.0495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7250 1.8708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9238 1.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5114 2.6662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5918 1.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7950 0.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2117 1.5619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5849 1.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1685 1.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9627 1.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1763 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5970 0.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7994 0.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5816 0.1818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9709 -0.3911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9082 0.5496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7813 -0.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6224 0.9619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6227 1.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3351 2.1970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0494 1.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0510 0.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3396 0.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 1 0
11 10 1 0
11 12 2 0
12 13 1 0
13 14 1 0
15 13 2 0
10 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
18 23 1 0
16 24 2 0
22 25 1 0
21 26 1 0
26 27 1 0
27 25 2 0
26 28 1 0
29 28 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.46Molecular Weight (Monoisotopic): 440.1597AlogP: 3.63#Rotatable Bonds: 6Polar Surface Area: 107.09Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.65CX Basic pKa: 2.57CX LogP: 4.06CX LogD: 2.55Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -1.81
References 1. Pippione AC, Kilic-Kurt Z, Kovachka S, Sainas S, Rolando B, Denasio E, Pors K, Adinolfi S, Zonari D, Bagnati R, Lolli ML, Spyrakis F, Oliaro-Bosso S, Boschi D.. (2022) New aldo-keto reductase 1C3 (AKR1C3) inhibitors based on the hydroxytriazole scaffold., 237 [PMID:35447434 ] [10.1016/j.ejmech.2022.114366 ]